2019-05-30 23:47:29 +02:00
|
|
|
|
2017-05-10 23:54:35 +02:00
|
|
|
// Copyright (c) 2011-present, Facebook, Inc. All rights reserved.
|
2017-07-16 01:03:42 +02:00
|
|
|
// This source code is licensed under both the GPLv2 (found in the
|
|
|
|
// COPYING file in the root directory) and Apache 2.0 License
|
|
|
|
// (found in the LICENSE.Apache file in the root directory).
|
2017-05-10 23:54:35 +02:00
|
|
|
#ifndef ROCKSDB_LITE
|
|
|
|
|
|
|
|
#include "utilities/blob_db/blob_db_impl.h"
|
|
|
|
#include <algorithm>
|
|
|
|
#include <cinttypes>
|
|
|
|
#include <iomanip>
|
|
|
|
#include <memory>
|
2019-11-19 01:28:04 +01:00
|
|
|
#include <sstream>
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2020-03-12 18:58:27 +01:00
|
|
|
#include "db/blob/blob_index.h"
|
2019-05-31 20:52:59 +02:00
|
|
|
#include "db/db_impl/db_impl.h"
|
2017-05-10 23:54:35 +02:00
|
|
|
#include "db/write_batch_internal.h"
|
Introduce a new storage specific Env API (#5761)
Summary:
The current Env API encompasses both storage/file operations, as well as OS related operations. Most of the APIs return a Status, which does not have enough metadata about an error, such as whether its retry-able or not, scope (i.e fault domain) of the error etc., that may be required in order to properly handle a storage error. The file APIs also do not provide enough control over the IO SLA, such as timeout, prioritization, hinting about placement and redundancy etc.
This PR separates out the file/storage APIs from Env into a new FileSystem class. The APIs are updated to return an IOStatus with metadata about the error, as well as to take an IOOptions structure as input in order to allow more control over the IO.
The user can set both ```options.env``` and ```options.file_system``` to specify that RocksDB should use the former for OS related operations and the latter for storage operations. Internally, a ```CompositeEnvWrapper``` has been introduced that inherits from ```Env``` and redirects individual methods to either an ```Env``` implementation or the ```FileSystem``` as appropriate. When options are sanitized during ```DB::Open```, ```options.env``` is replaced with a newly allocated ```CompositeEnvWrapper``` instance if both env and file_system have been specified. This way, the rest of the RocksDB code can continue to function as before.
This PR also ports PosixEnv to the new API by splitting it into two - PosixEnv and PosixFileSystem. PosixEnv is defined as a sub-class of CompositeEnvWrapper, and threading/time functions are overridden with Posix specific implementations in order to avoid an extra level of indirection.
The ```CompositeEnvWrapper``` translates ```IOStatus``` return code to ```Status```, and sets the severity to ```kSoftError``` if the io_status is retryable. The error handling code in RocksDB can then recover the DB automatically.
Pull Request resolved: https://github.com/facebook/rocksdb/pull/5761
Differential Revision: D18868376
Pulled By: anand1976
fbshipit-source-id: 39efe18a162ea746fabac6360ff529baba48486f
2019-12-13 23:47:08 +01:00
|
|
|
#include "env/composite_env_wrapper.h"
|
2019-05-30 05:44:08 +02:00
|
|
|
#include "file/file_util.h"
|
|
|
|
#include "file/filename.h"
|
2019-09-16 19:31:27 +02:00
|
|
|
#include "file/random_access_file_reader.h"
|
2019-05-30 05:44:08 +02:00
|
|
|
#include "file/sst_file_manager_impl.h"
|
2019-09-16 19:31:27 +02:00
|
|
|
#include "file/writable_file_writer.h"
|
2019-06-01 02:19:43 +02:00
|
|
|
#include "logging/logging.h"
|
2017-05-10 23:54:35 +02:00
|
|
|
#include "monitoring/instrumented_mutex.h"
|
2017-11-28 20:42:28 +01:00
|
|
|
#include "monitoring/statistics.h"
|
2017-05-10 23:54:35 +02:00
|
|
|
#include "rocksdb/convenience.h"
|
|
|
|
#include "rocksdb/env.h"
|
|
|
|
#include "rocksdb/iterator.h"
|
|
|
|
#include "rocksdb/utilities/stackable_db.h"
|
|
|
|
#include "rocksdb/utilities/transaction.h"
|
2019-05-30 23:47:29 +02:00
|
|
|
#include "table/block_based/block.h"
|
|
|
|
#include "table/block_based/block_based_table_builder.h"
|
|
|
|
#include "table/block_based/block_builder.h"
|
2017-05-10 23:54:35 +02:00
|
|
|
#include "table/meta_blocks.h"
|
2019-05-31 02:39:43 +02:00
|
|
|
#include "test_util/sync_point.h"
|
2017-07-29 01:23:50 +02:00
|
|
|
#include "util/cast_util.h"
|
2017-05-10 23:54:35 +02:00
|
|
|
#include "util/crc32c.h"
|
2017-08-04 00:07:01 +02:00
|
|
|
#include "util/mutexlock.h"
|
2017-05-10 23:54:35 +02:00
|
|
|
#include "util/random.h"
|
2017-11-28 20:42:28 +01:00
|
|
|
#include "util/stop_watch.h"
|
2017-05-10 23:54:35 +02:00
|
|
|
#include "util/timer_queue.h"
|
2017-12-11 21:01:22 +01:00
|
|
|
#include "utilities/blob_db/blob_compaction_filter.h"
|
2017-10-18 02:24:25 +02:00
|
|
|
#include "utilities/blob_db/blob_db_iterator.h"
|
2018-03-06 20:46:20 +01:00
|
|
|
#include "utilities/blob_db/blob_db_listener.h"
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
namespace {
|
|
|
|
int kBlockBasedTableVersionFormat = 2;
|
|
|
|
} // end namespace
|
|
|
|
|
2020-02-20 21:07:53 +01:00
|
|
|
namespace ROCKSDB_NAMESPACE {
|
2017-05-10 23:54:35 +02:00
|
|
|
namespace blob_db {
|
|
|
|
|
2018-06-26 07:32:29 +02:00
|
|
|
bool BlobFileComparator::operator()(
|
|
|
|
const std::shared_ptr<BlobFile>& lhs,
|
|
|
|
const std::shared_ptr<BlobFile>& rhs) const {
|
|
|
|
return lhs->BlobFileNumber() > rhs->BlobFileNumber();
|
|
|
|
}
|
|
|
|
|
|
|
|
bool BlobFileComparatorTTL::operator()(
|
|
|
|
const std::shared_ptr<BlobFile>& lhs,
|
|
|
|
const std::shared_ptr<BlobFile>& rhs) const {
|
2018-03-06 20:46:20 +01:00
|
|
|
assert(lhs->HasTTL() && rhs->HasTTL());
|
2017-10-27 22:14:34 +02:00
|
|
|
if (lhs->expiration_range_.first < rhs->expiration_range_.first) {
|
|
|
|
return true;
|
|
|
|
}
|
|
|
|
if (lhs->expiration_range_.first > rhs->expiration_range_.first) {
|
|
|
|
return false;
|
|
|
|
}
|
2017-11-02 20:02:42 +01:00
|
|
|
return lhs->BlobFileNumber() < rhs->BlobFileNumber();
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
BlobDBImpl::BlobDBImpl(const std::string& dbname,
|
|
|
|
const BlobDBOptions& blob_db_options,
|
2017-12-11 21:01:22 +01:00
|
|
|
const DBOptions& db_options,
|
|
|
|
const ColumnFamilyOptions& cf_options)
|
|
|
|
: BlobDB(),
|
|
|
|
dbname_(dbname),
|
2017-05-10 23:54:35 +02:00
|
|
|
db_impl_(nullptr),
|
2017-07-28 08:16:18 +02:00
|
|
|
env_(db_options.env),
|
2017-05-10 23:54:35 +02:00
|
|
|
bdb_options_(blob_db_options),
|
|
|
|
db_options_(db_options),
|
2017-12-11 21:01:22 +01:00
|
|
|
cf_options_(cf_options),
|
2017-05-10 23:54:35 +02:00
|
|
|
env_options_(db_options),
|
2017-11-28 20:42:28 +01:00
|
|
|
statistics_(db_options_.statistics.get()),
|
2017-05-10 23:54:35 +02:00
|
|
|
next_file_number_(1),
|
2019-11-19 01:28:04 +01:00
|
|
|
flush_sequence_(0),
|
2018-03-06 20:46:20 +01:00
|
|
|
closed_(true),
|
2017-05-10 23:54:35 +02:00
|
|
|
open_file_count_(0),
|
2018-03-06 20:46:20 +01:00
|
|
|
total_blob_size_(0),
|
|
|
|
live_sst_size_(0),
|
|
|
|
fifo_eviction_seq_(0),
|
|
|
|
evict_expiration_up_to_(0),
|
|
|
|
debug_level_(0) {
|
2017-05-10 23:54:35 +02:00
|
|
|
blob_dir_ = (bdb_options_.path_relative)
|
|
|
|
? dbname + "/" + bdb_options_.blob_dir
|
|
|
|
: bdb_options_.blob_dir;
|
2017-12-20 01:34:25 +01:00
|
|
|
env_options_.bytes_per_sync = blob_db_options.bytes_per_sync;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
BlobDBImpl::~BlobDBImpl() {
|
2019-02-22 02:23:05 +01:00
|
|
|
tqueue_.shutdown();
|
2017-12-11 21:01:22 +01:00
|
|
|
// CancelAllBackgroundWork(db_, true);
|
2018-03-06 20:46:20 +01:00
|
|
|
Status s __attribute__((__unused__)) = Close();
|
|
|
|
assert(s.ok());
|
|
|
|
}
|
|
|
|
|
|
|
|
Status BlobDBImpl::Close() {
|
|
|
|
if (closed_) {
|
|
|
|
return Status::OK();
|
|
|
|
}
|
|
|
|
closed_ = true;
|
2017-12-11 21:01:22 +01:00
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
// Close base DB before BlobDBImpl destructs to stop event listener and
|
|
|
|
// compaction filter call.
|
|
|
|
Status s = db_->Close();
|
|
|
|
// delete db_ anyway even if close failed.
|
|
|
|
delete db_;
|
|
|
|
// Reset pointers to avoid StackableDB delete the pointer again.
|
|
|
|
db_ = nullptr;
|
|
|
|
db_impl_ = nullptr;
|
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
|
|
|
s = SyncBlobFiles();
|
|
|
|
return s;
|
2017-12-11 21:01:22 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
BlobDBOptions BlobDBImpl::GetBlobDBOptions() const { return bdb_options_; }
|
|
|
|
|
|
|
|
Status BlobDBImpl::Open(std::vector<ColumnFamilyHandle*>* handles) {
|
|
|
|
assert(handles != nullptr);
|
2017-05-10 23:54:35 +02:00
|
|
|
assert(db_ == nullptr);
|
2019-12-13 19:11:03 +01:00
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
if (blob_dir_.empty()) {
|
|
|
|
return Status::NotSupported("No blob directory in options");
|
|
|
|
}
|
2019-12-13 19:11:03 +01:00
|
|
|
|
|
|
|
if (bdb_options_.garbage_collection_cutoff < 0.0 ||
|
|
|
|
bdb_options_.garbage_collection_cutoff > 1.0) {
|
|
|
|
return Status::InvalidArgument(
|
|
|
|
"Garbage collection cutoff must be in the interval [0.0, 1.0]");
|
|
|
|
}
|
|
|
|
|
2019-11-11 23:00:25 +01:00
|
|
|
// Temporarily disable compactions in the base DB during open; save the user
|
|
|
|
// defined value beforehand so we can restore it once BlobDB is initialized.
|
|
|
|
// Note: this is only needed if garbage collection is enabled.
|
|
|
|
const bool disable_auto_compactions = cf_options_.disable_auto_compactions;
|
|
|
|
|
|
|
|
if (bdb_options_.enable_garbage_collection) {
|
|
|
|
cf_options_.disable_auto_compactions = true;
|
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
Status s;
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
// Create info log.
|
|
|
|
if (db_options_.info_log == nullptr) {
|
|
|
|
s = CreateLoggerFromOptions(dbname_, db_options_, &db_options_.info_log);
|
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
|
|
|
}
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
ROCKS_LOG_INFO(db_options_.info_log, "Opening BlobDB...");
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2020-06-30 02:30:04 +02:00
|
|
|
if ((cf_options_.compaction_filter != nullptr ||
|
|
|
|
cf_options_.compaction_filter_factory != nullptr)) {
|
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"BlobDB only support compaction filter on non-TTL values.");
|
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
// Open blob directory.
|
|
|
|
s = env_->CreateDirIfMissing(blob_dir_);
|
2017-05-10 23:54:35 +02:00
|
|
|
if (!s.ok()) {
|
2017-12-11 21:01:22 +01:00
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
|
|
|
"Failed to create blob_dir %s, status: %s",
|
|
|
|
blob_dir_.c_str(), s.ToString().c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
2017-07-28 08:16:18 +02:00
|
|
|
s = env_->NewDirectory(blob_dir_, &dir_ent_);
|
2017-05-10 23:54:35 +02:00
|
|
|
if (!s.ok()) {
|
2017-12-11 21:01:22 +01:00
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
|
|
|
"Failed to open blob_dir %s, status: %s", blob_dir_.c_str(),
|
|
|
|
s.ToString().c_str());
|
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
// Open blob files.
|
|
|
|
s = OpenAllBlobFiles();
|
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
2017-06-14 22:08:54 +02:00
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
// Update options
|
2019-12-13 19:11:03 +01:00
|
|
|
if (bdb_options_.enable_garbage_collection) {
|
|
|
|
db_options_.listeners.push_back(std::make_shared<BlobDBListenerGC>(this));
|
|
|
|
cf_options_.compaction_filter_factory =
|
2020-06-30 02:30:04 +02:00
|
|
|
std::make_shared<BlobIndexCompactionFilterFactoryGC>(
|
|
|
|
this, env_, cf_options_, statistics_);
|
2019-12-13 19:11:03 +01:00
|
|
|
} else {
|
|
|
|
db_options_.listeners.push_back(std::make_shared<BlobDBListener>(this));
|
|
|
|
cf_options_.compaction_filter_factory =
|
2020-06-30 02:30:04 +02:00
|
|
|
std::make_shared<BlobIndexCompactionFilterFactory>(
|
|
|
|
this, env_, cf_options_, statistics_);
|
2019-12-13 19:11:03 +01:00
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2020-06-30 02:30:04 +02:00
|
|
|
// Reset user compaction filter after building into compaction factory.
|
|
|
|
cf_options_.compaction_filter = nullptr;
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
// Open base db.
|
|
|
|
ColumnFamilyDescriptor cf_descriptor(kDefaultColumnFamilyName, cf_options_);
|
|
|
|
s = DB::Open(db_options_, dbname_, {cf_descriptor}, handles, &db_);
|
2017-05-10 23:54:35 +02:00
|
|
|
if (!s.ok()) {
|
2017-12-11 21:01:22 +01:00
|
|
|
return s;
|
|
|
|
}
|
2020-04-29 22:06:27 +02:00
|
|
|
db_impl_ = static_cast_with_check<DBImpl>(db_->GetRootDB());
|
2019-03-26 18:43:22 +01:00
|
|
|
|
2020-05-06 22:58:25 +02:00
|
|
|
// Sanitize the blob_dir provided. Using a directory where the
|
|
|
|
// base DB stores its files for the default CF is not supported.
|
|
|
|
const ColumnFamilyData* const cfd =
|
|
|
|
static_cast<ColumnFamilyHandleImpl*>(DefaultColumnFamily())->cfd();
|
|
|
|
assert(cfd);
|
|
|
|
|
|
|
|
const ImmutableCFOptions* const ioptions = cfd->ioptions();
|
|
|
|
assert(ioptions);
|
|
|
|
|
|
|
|
assert(env_);
|
|
|
|
|
|
|
|
for (const auto& cf_path : ioptions->cf_paths) {
|
|
|
|
bool blob_dir_same_as_cf_dir = false;
|
|
|
|
s = env_->AreFilesSame(blob_dir_, cf_path.path, &blob_dir_same_as_cf_dir);
|
|
|
|
if (!s.ok()) {
|
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
|
|
|
"Error while sanitizing blob_dir %s, status: %s",
|
|
|
|
blob_dir_.c_str(), s.ToString().c_str());
|
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (blob_dir_same_as_cf_dir) {
|
|
|
|
return Status::NotSupported(
|
|
|
|
"Using the base DB's storage directories for BlobDB files is not "
|
|
|
|
"supported.");
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2019-11-11 23:00:25 +01:00
|
|
|
// Initialize SST file <-> oldest blob file mapping if garbage collection
|
|
|
|
// is enabled.
|
|
|
|
if (bdb_options_.enable_garbage_collection) {
|
|
|
|
std::vector<LiveFileMetaData> live_files;
|
|
|
|
db_->GetLiveFilesMetaData(&live_files);
|
|
|
|
|
|
|
|
InitializeBlobFileToSstMapping(live_files);
|
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
MarkUnreferencedBlobFilesObsoleteDuringOpen();
|
|
|
|
|
2019-11-11 23:00:25 +01:00
|
|
|
if (!disable_auto_compactions) {
|
|
|
|
s = db_->EnableAutoCompaction(*handles);
|
|
|
|
if (!s.ok()) {
|
|
|
|
ROCKS_LOG_ERROR(
|
|
|
|
db_options_.info_log,
|
|
|
|
"Failed to enable automatic compactions during open, status: %s",
|
|
|
|
s.ToString().c_str());
|
|
|
|
return s;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2019-03-26 18:43:22 +01:00
|
|
|
// Add trash files in blob dir to file delete scheduler.
|
|
|
|
SstFileManagerImpl* sfm = static_cast<SstFileManagerImpl*>(
|
|
|
|
db_impl_->immutable_db_options().sst_file_manager.get());
|
|
|
|
DeleteScheduler::CleanupDirectory(env_, sfm, blob_dir_);
|
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
UpdateLiveSSTSize();
|
2017-12-11 21:01:22 +01:00
|
|
|
|
|
|
|
// Start background jobs.
|
|
|
|
if (!bdb_options_.disable_background_tasks) {
|
|
|
|
StartBackgroundTasks();
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
ROCKS_LOG_INFO(db_options_.info_log, "BlobDB pointer %p", this);
|
2017-12-20 01:50:59 +01:00
|
|
|
bdb_options_.Dump(db_options_.info_log.get());
|
2018-03-06 20:46:20 +01:00
|
|
|
closed_ = false;
|
2017-05-10 23:54:35 +02:00
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
|
|
|
void BlobDBImpl::StartBackgroundTasks() {
|
|
|
|
// store a call to a member function and object
|
|
|
|
tqueue_.add(
|
2017-08-01 21:48:22 +02:00
|
|
|
kReclaimOpenFilesPeriodMillisecs,
|
2017-05-10 23:54:35 +02:00
|
|
|
std::bind(&BlobDBImpl::ReclaimOpenFiles, this, std::placeholders::_1));
|
|
|
|
tqueue_.add(
|
2017-08-21 03:12:38 +02:00
|
|
|
kDeleteObsoleteFilesPeriodMillisecs,
|
|
|
|
std::bind(&BlobDBImpl::DeleteObsoleteFiles, this, std::placeholders::_1));
|
2017-08-01 21:48:22 +02:00
|
|
|
tqueue_.add(kSanityCheckPeriodMillisecs,
|
2017-05-10 23:54:35 +02:00
|
|
|
std::bind(&BlobDBImpl::SanityCheck, this, std::placeholders::_1));
|
|
|
|
tqueue_.add(
|
2018-08-21 07:38:34 +02:00
|
|
|
kEvictExpiredFilesPeriodMillisecs,
|
|
|
|
std::bind(&BlobDBImpl::EvictExpiredFiles, this, std::placeholders::_1));
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
Status BlobDBImpl::GetAllBlobFiles(std::set<uint64_t>* file_numbers) {
|
|
|
|
assert(file_numbers != nullptr);
|
2017-05-10 23:54:35 +02:00
|
|
|
std::vector<std::string> all_files;
|
2017-12-11 21:01:22 +01:00
|
|
|
Status s = env_->GetChildren(blob_dir_, &all_files);
|
|
|
|
if (!s.ok()) {
|
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
|
|
|
"Failed to get list of blob files, status: %s",
|
|
|
|
s.ToString().c_str());
|
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
for (const auto& file_name : all_files) {
|
|
|
|
uint64_t file_number;
|
2017-05-10 23:54:35 +02:00
|
|
|
FileType type;
|
2017-12-11 21:01:22 +01:00
|
|
|
bool success = ParseFileName(file_name, &file_number, &type);
|
|
|
|
if (success && type == kBlobFile) {
|
|
|
|
file_numbers->insert(file_number);
|
2017-05-10 23:54:35 +02:00
|
|
|
} else {
|
2017-07-13 19:03:39 +02:00
|
|
|
ROCKS_LOG_WARN(db_options_.info_log,
|
2017-12-11 21:01:22 +01:00
|
|
|
"Skipping file in blob directory: %s", file_name.c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
Status BlobDBImpl::OpenAllBlobFiles() {
|
|
|
|
std::set<uint64_t> file_numbers;
|
|
|
|
Status s = GetAllBlobFiles(&file_numbers);
|
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
if (!file_numbers.empty()) {
|
|
|
|
next_file_number_.store(*file_numbers.rbegin() + 1);
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
std::ostringstream blob_file_oss;
|
|
|
|
std::ostringstream live_imm_oss;
|
|
|
|
std::ostringstream obsolete_file_oss;
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
for (auto& file_number : file_numbers) {
|
|
|
|
std::shared_ptr<BlobFile> blob_file = std::make_shared<BlobFile>(
|
|
|
|
this, blob_dir_, file_number, db_options_.info_log.get());
|
2019-11-19 01:28:04 +01:00
|
|
|
blob_file->MarkImmutable(/* sequence */ 0);
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
// Read file header and footer
|
|
|
|
Status read_metadata_status = blob_file->ReadMetadata(env_, env_options_);
|
|
|
|
if (read_metadata_status.IsCorruption()) {
|
|
|
|
// Remove incomplete file.
|
2019-11-19 01:28:04 +01:00
|
|
|
if (!obsolete_files_.empty()) {
|
|
|
|
obsolete_file_oss << ", ";
|
2017-12-11 21:01:22 +01:00
|
|
|
}
|
2019-11-19 01:28:04 +01:00
|
|
|
obsolete_file_oss << file_number;
|
|
|
|
|
|
|
|
ObsoleteBlobFile(blob_file, 0 /*obsolete_seq*/, false /*update_size*/);
|
2017-12-11 21:01:22 +01:00
|
|
|
continue;
|
|
|
|
} else if (!read_metadata_status.ok()) {
|
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
2019-04-04 21:05:42 +02:00
|
|
|
"Unable to read metadata of blob file %" PRIu64
|
2017-12-11 21:01:22 +01:00
|
|
|
", status: '%s'",
|
|
|
|
file_number, read_metadata_status.ToString().c_str());
|
|
|
|
return read_metadata_status;
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
total_blob_size_ += blob_file->GetFileSize();
|
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
if (!blob_files_.empty()) {
|
|
|
|
blob_file_oss << ", ";
|
|
|
|
}
|
|
|
|
blob_file_oss << file_number;
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
blob_files_[file_number] = blob_file;
|
2019-11-19 01:28:04 +01:00
|
|
|
|
|
|
|
if (!blob_file->HasTTL()) {
|
|
|
|
if (!live_imm_non_ttl_blob_files_.empty()) {
|
|
|
|
live_imm_oss << ", ";
|
|
|
|
}
|
|
|
|
live_imm_oss << file_number;
|
|
|
|
|
|
|
|
live_imm_non_ttl_blob_files_[file_number] = blob_file;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"Found %" ROCKSDB_PRIszt " blob files: %s", blob_files_.size(),
|
2019-11-19 01:28:04 +01:00
|
|
|
blob_file_oss.str().c_str());
|
|
|
|
ROCKS_LOG_INFO(
|
|
|
|
db_options_.info_log, "Found %" ROCKSDB_PRIszt " non-TTL blob files: %s",
|
|
|
|
live_imm_non_ttl_blob_files_.size(), live_imm_oss.str().c_str());
|
2017-12-11 21:01:22 +01:00
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"Found %" ROCKSDB_PRIszt
|
|
|
|
" incomplete or corrupted blob files: %s",
|
2019-11-19 01:28:04 +01:00
|
|
|
obsolete_files_.size(), obsolete_file_oss.str().c_str());
|
2017-12-11 21:01:22 +01:00
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-11 23:00:25 +01:00
|
|
|
template <typename Linker>
|
|
|
|
void BlobDBImpl::LinkSstToBlobFileImpl(uint64_t sst_file_number,
|
|
|
|
uint64_t blob_file_number,
|
|
|
|
Linker linker) {
|
|
|
|
assert(bdb_options_.enable_garbage_collection);
|
|
|
|
assert(blob_file_number != kInvalidBlobFileNumber);
|
|
|
|
|
|
|
|
auto it = blob_files_.find(blob_file_number);
|
|
|
|
if (it == blob_files_.end()) {
|
|
|
|
ROCKS_LOG_WARN(db_options_.info_log,
|
|
|
|
"Blob file %" PRIu64
|
|
|
|
" not found while trying to link "
|
|
|
|
"SST file %" PRIu64,
|
|
|
|
blob_file_number, sst_file_number);
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
BlobFile* const blob_file = it->second.get();
|
|
|
|
assert(blob_file);
|
|
|
|
|
|
|
|
linker(blob_file, sst_file_number);
|
|
|
|
|
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"Blob file %" PRIu64 " linked to SST file %" PRIu64,
|
|
|
|
blob_file_number, sst_file_number);
|
|
|
|
}
|
|
|
|
|
|
|
|
void BlobDBImpl::LinkSstToBlobFile(uint64_t sst_file_number,
|
|
|
|
uint64_t blob_file_number) {
|
|
|
|
auto linker = [](BlobFile* blob_file, uint64_t sst_file) {
|
|
|
|
WriteLock file_lock(&blob_file->mutex_);
|
|
|
|
blob_file->LinkSstFile(sst_file);
|
|
|
|
};
|
|
|
|
|
|
|
|
LinkSstToBlobFileImpl(sst_file_number, blob_file_number, linker);
|
|
|
|
}
|
|
|
|
|
|
|
|
void BlobDBImpl::LinkSstToBlobFileNoLock(uint64_t sst_file_number,
|
|
|
|
uint64_t blob_file_number) {
|
|
|
|
auto linker = [](BlobFile* blob_file, uint64_t sst_file) {
|
|
|
|
blob_file->LinkSstFile(sst_file);
|
|
|
|
};
|
|
|
|
|
|
|
|
LinkSstToBlobFileImpl(sst_file_number, blob_file_number, linker);
|
|
|
|
}
|
|
|
|
|
|
|
|
void BlobDBImpl::UnlinkSstFromBlobFile(uint64_t sst_file_number,
|
|
|
|
uint64_t blob_file_number) {
|
|
|
|
assert(bdb_options_.enable_garbage_collection);
|
|
|
|
assert(blob_file_number != kInvalidBlobFileNumber);
|
|
|
|
|
|
|
|
auto it = blob_files_.find(blob_file_number);
|
|
|
|
if (it == blob_files_.end()) {
|
|
|
|
ROCKS_LOG_WARN(db_options_.info_log,
|
|
|
|
"Blob file %" PRIu64
|
|
|
|
" not found while trying to unlink "
|
|
|
|
"SST file %" PRIu64,
|
|
|
|
blob_file_number, sst_file_number);
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
BlobFile* const blob_file = it->second.get();
|
|
|
|
assert(blob_file);
|
|
|
|
|
|
|
|
{
|
|
|
|
WriteLock file_lock(&blob_file->mutex_);
|
|
|
|
blob_file->UnlinkSstFile(sst_file_number);
|
|
|
|
}
|
|
|
|
|
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"Blob file %" PRIu64 " unlinked from SST file %" PRIu64,
|
|
|
|
blob_file_number, sst_file_number);
|
|
|
|
}
|
|
|
|
|
|
|
|
void BlobDBImpl::InitializeBlobFileToSstMapping(
|
|
|
|
const std::vector<LiveFileMetaData>& live_files) {
|
|
|
|
assert(bdb_options_.enable_garbage_collection);
|
|
|
|
|
|
|
|
for (const auto& live_file : live_files) {
|
|
|
|
const uint64_t sst_file_number = live_file.file_number;
|
|
|
|
const uint64_t blob_file_number = live_file.oldest_blob_file_number;
|
|
|
|
|
|
|
|
if (blob_file_number == kInvalidBlobFileNumber) {
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
|
|
|
|
LinkSstToBlobFileNoLock(sst_file_number, blob_file_number);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
void BlobDBImpl::ProcessFlushJobInfo(const FlushJobInfo& info) {
|
|
|
|
assert(bdb_options_.enable_garbage_collection);
|
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
WriteLock lock(&mutex_);
|
2019-11-11 23:00:25 +01:00
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
if (info.oldest_blob_file_number != kInvalidBlobFileNumber) {
|
2019-11-11 23:00:25 +01:00
|
|
|
LinkSstToBlobFile(info.file_number, info.oldest_blob_file_number);
|
|
|
|
}
|
2019-11-19 01:28:04 +01:00
|
|
|
|
|
|
|
assert(flush_sequence_ < info.largest_seqno);
|
|
|
|
flush_sequence_ = info.largest_seqno;
|
|
|
|
|
|
|
|
MarkUnreferencedBlobFilesObsolete();
|
2019-11-11 23:00:25 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
void BlobDBImpl::ProcessCompactionJobInfo(const CompactionJobInfo& info) {
|
|
|
|
assert(bdb_options_.enable_garbage_collection);
|
|
|
|
|
2019-12-12 20:29:01 +01:00
|
|
|
if (!info.status.ok()) {
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
2019-11-11 23:00:25 +01:00
|
|
|
// Note: the same SST file may appear in both the input and the output
|
2020-02-07 21:49:11 +01:00
|
|
|
// file list in case of a trivial move. We walk through the two lists
|
|
|
|
// below in a fashion that's similar to merge sort to detect this.
|
|
|
|
|
|
|
|
auto cmp = [](const CompactionFileInfo& lhs, const CompactionFileInfo& rhs) {
|
|
|
|
return lhs.file_number < rhs.file_number;
|
|
|
|
};
|
|
|
|
|
|
|
|
auto inputs = info.input_file_infos;
|
|
|
|
auto iit = inputs.begin();
|
|
|
|
const auto iit_end = inputs.end();
|
|
|
|
|
|
|
|
std::sort(iit, iit_end, cmp);
|
|
|
|
|
|
|
|
auto outputs = info.output_file_infos;
|
|
|
|
auto oit = outputs.begin();
|
|
|
|
const auto oit_end = outputs.end();
|
|
|
|
|
|
|
|
std::sort(oit, oit_end, cmp);
|
2019-11-11 23:00:25 +01:00
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
WriteLock lock(&mutex_);
|
2019-11-11 23:00:25 +01:00
|
|
|
|
2020-02-07 21:49:11 +01:00
|
|
|
while (iit != iit_end && oit != oit_end) {
|
|
|
|
const auto& input = *iit;
|
|
|
|
const auto& output = *oit;
|
|
|
|
|
|
|
|
if (input.file_number == output.file_number) {
|
|
|
|
++iit;
|
|
|
|
++oit;
|
|
|
|
} else if (input.file_number < output.file_number) {
|
|
|
|
if (input.oldest_blob_file_number != kInvalidBlobFileNumber) {
|
|
|
|
UnlinkSstFromBlobFile(input.file_number, input.oldest_blob_file_number);
|
|
|
|
}
|
|
|
|
|
|
|
|
++iit;
|
|
|
|
} else {
|
|
|
|
assert(output.file_number < input.file_number);
|
|
|
|
|
|
|
|
if (output.oldest_blob_file_number != kInvalidBlobFileNumber) {
|
|
|
|
LinkSstToBlobFile(output.file_number, output.oldest_blob_file_number);
|
|
|
|
}
|
|
|
|
|
|
|
|
++oit;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
while (iit != iit_end) {
|
|
|
|
const auto& input = *iit;
|
|
|
|
|
|
|
|
if (input.oldest_blob_file_number != kInvalidBlobFileNumber) {
|
|
|
|
UnlinkSstFromBlobFile(input.file_number, input.oldest_blob_file_number);
|
2019-11-19 01:28:04 +01:00
|
|
|
}
|
2019-11-11 23:00:25 +01:00
|
|
|
|
2020-02-07 21:49:11 +01:00
|
|
|
++iit;
|
2019-11-19 01:28:04 +01:00
|
|
|
}
|
|
|
|
|
2020-02-07 21:49:11 +01:00
|
|
|
while (oit != oit_end) {
|
|
|
|
const auto& output = *oit;
|
|
|
|
|
|
|
|
if (output.oldest_blob_file_number != kInvalidBlobFileNumber) {
|
|
|
|
LinkSstToBlobFile(output.file_number, output.oldest_blob_file_number);
|
2019-11-11 23:00:25 +01:00
|
|
|
}
|
|
|
|
|
2020-02-07 21:49:11 +01:00
|
|
|
++oit;
|
2019-11-19 01:28:04 +01:00
|
|
|
}
|
2019-11-11 23:00:25 +01:00
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
MarkUnreferencedBlobFilesObsolete();
|
|
|
|
}
|
|
|
|
|
|
|
|
bool BlobDBImpl::MarkBlobFileObsoleteIfNeeded(
|
|
|
|
const std::shared_ptr<BlobFile>& blob_file, SequenceNumber obsolete_seq) {
|
|
|
|
assert(blob_file);
|
|
|
|
assert(!blob_file->HasTTL());
|
|
|
|
assert(blob_file->Immutable());
|
|
|
|
assert(bdb_options_.enable_garbage_collection);
|
|
|
|
|
|
|
|
// Note: FIFO eviction could have marked this file obsolete already.
|
|
|
|
if (blob_file->Obsolete()) {
|
|
|
|
return true;
|
|
|
|
}
|
|
|
|
|
|
|
|
// We cannot mark this file (or any higher-numbered files for that matter)
|
|
|
|
// obsolete if it is referenced by any memtables or SSTs. We keep track of
|
|
|
|
// the SSTs explicitly. To account for memtables, we keep track of the highest
|
|
|
|
// sequence number received in flush notifications, and we do not mark the
|
|
|
|
// blob file obsolete if there are still unflushed memtables from before
|
|
|
|
// the time the blob file was closed.
|
|
|
|
if (blob_file->GetImmutableSequence() > flush_sequence_ ||
|
|
|
|
!blob_file->GetLinkedSstFiles().empty()) {
|
|
|
|
return false;
|
|
|
|
}
|
|
|
|
|
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"Blob file %" PRIu64 " is no longer needed, marking obsolete",
|
|
|
|
blob_file->BlobFileNumber());
|
|
|
|
|
|
|
|
ObsoleteBlobFile(blob_file, obsolete_seq, /* update_size */ true);
|
|
|
|
return true;
|
|
|
|
}
|
|
|
|
|
|
|
|
template <class Functor>
|
|
|
|
void BlobDBImpl::MarkUnreferencedBlobFilesObsoleteImpl(Functor mark_if_needed) {
|
|
|
|
assert(bdb_options_.enable_garbage_collection);
|
|
|
|
|
|
|
|
// Iterate through all live immutable non-TTL blob files, and mark them
|
|
|
|
// obsolete assuming no SST files or memtables rely on the blobs in them.
|
|
|
|
// Note: we need to stop as soon as we find a blob file that has any
|
|
|
|
// linked SSTs (or one potentially referenced by memtables).
|
|
|
|
|
2020-01-30 01:42:16 +01:00
|
|
|
uint64_t obsoleted_files = 0;
|
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
auto it = live_imm_non_ttl_blob_files_.begin();
|
|
|
|
while (it != live_imm_non_ttl_blob_files_.end()) {
|
|
|
|
const auto& blob_file = it->second;
|
|
|
|
assert(blob_file);
|
|
|
|
assert(blob_file->BlobFileNumber() == it->first);
|
|
|
|
assert(!blob_file->HasTTL());
|
|
|
|
assert(blob_file->Immutable());
|
|
|
|
|
|
|
|
// Small optimization: Obsolete() does an atomic read, so we can do
|
|
|
|
// this check without taking a lock on the blob file's mutex.
|
|
|
|
if (blob_file->Obsolete()) {
|
|
|
|
it = live_imm_non_ttl_blob_files_.erase(it);
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (!mark_if_needed(blob_file)) {
|
|
|
|
break;
|
2019-11-11 23:00:25 +01:00
|
|
|
}
|
2019-11-19 01:28:04 +01:00
|
|
|
|
|
|
|
it = live_imm_non_ttl_blob_files_.erase(it);
|
2020-01-30 01:42:16 +01:00
|
|
|
|
|
|
|
++obsoleted_files;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (obsoleted_files > 0) {
|
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"%" PRIu64 " blob file(s) marked obsolete by GC",
|
|
|
|
obsoleted_files);
|
|
|
|
RecordTick(statistics_, BLOB_DB_GC_NUM_FILES, obsoleted_files);
|
2019-11-11 23:00:25 +01:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
void BlobDBImpl::MarkUnreferencedBlobFilesObsolete() {
|
|
|
|
const SequenceNumber obsolete_seq = GetLatestSequenceNumber();
|
|
|
|
|
|
|
|
MarkUnreferencedBlobFilesObsoleteImpl(
|
2020-04-20 22:21:34 +02:00
|
|
|
[this, obsolete_seq](const std::shared_ptr<BlobFile>& blob_file) {
|
2019-11-19 01:28:04 +01:00
|
|
|
WriteLock file_lock(&blob_file->mutex_);
|
|
|
|
return MarkBlobFileObsoleteIfNeeded(blob_file, obsolete_seq);
|
|
|
|
});
|
|
|
|
}
|
|
|
|
|
|
|
|
void BlobDBImpl::MarkUnreferencedBlobFilesObsoleteDuringOpen() {
|
|
|
|
MarkUnreferencedBlobFilesObsoleteImpl(
|
2020-04-20 22:21:34 +02:00
|
|
|
[this](const std::shared_ptr<BlobFile>& blob_file) {
|
2019-11-19 01:28:04 +01:00
|
|
|
return MarkBlobFileObsoleteIfNeeded(blob_file, /* obsolete_seq */ 0);
|
|
|
|
});
|
|
|
|
}
|
|
|
|
|
2017-05-10 23:54:35 +02:00
|
|
|
void BlobDBImpl::CloseRandomAccessLocked(
|
|
|
|
const std::shared_ptr<BlobFile>& bfile) {
|
|
|
|
bfile->CloseRandomAccessLocked();
|
|
|
|
open_file_count_--;
|
|
|
|
}
|
|
|
|
|
2018-09-21 01:50:07 +02:00
|
|
|
Status BlobDBImpl::GetBlobFileReader(
|
|
|
|
const std::shared_ptr<BlobFile>& blob_file,
|
|
|
|
std::shared_ptr<RandomAccessFileReader>* reader) {
|
|
|
|
assert(reader != nullptr);
|
2017-05-10 23:54:35 +02:00
|
|
|
bool fresh_open = false;
|
2018-09-21 01:50:07 +02:00
|
|
|
Status s = blob_file->GetReader(env_, env_options_, reader, &fresh_open);
|
|
|
|
if (s.ok() && fresh_open) {
|
|
|
|
assert(*reader != nullptr);
|
|
|
|
open_file_count_++;
|
|
|
|
}
|
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
std::shared_ptr<BlobFile> BlobDBImpl::NewBlobFile(
|
|
|
|
bool has_ttl, const ExpirationRange& expiration_range,
|
|
|
|
const std::string& reason) {
|
|
|
|
assert(has_ttl == (expiration_range.first || expiration_range.second));
|
|
|
|
|
2017-05-10 23:54:35 +02:00
|
|
|
uint64_t file_num = next_file_number_++;
|
2019-11-26 22:16:39 +01:00
|
|
|
|
|
|
|
const uint32_t column_family_id =
|
|
|
|
static_cast<ColumnFamilyHandleImpl*>(DefaultColumnFamily())->GetID();
|
|
|
|
auto blob_file = std::make_shared<BlobFile>(
|
|
|
|
this, blob_dir_, file_num, db_options_.info_log.get(), column_family_id,
|
|
|
|
bdb_options_.compression, has_ttl, expiration_range);
|
|
|
|
|
2017-07-13 19:03:39 +02:00
|
|
|
ROCKS_LOG_DEBUG(db_options_.info_log, "New blob file created: %s reason='%s'",
|
2019-11-26 22:16:39 +01:00
|
|
|
blob_file->PathName().c_str(), reason.c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
LogFlush(db_options_.info_log);
|
2019-11-26 22:16:39 +01:00
|
|
|
|
|
|
|
return blob_file;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-12-13 19:11:03 +01:00
|
|
|
void BlobDBImpl::RegisterBlobFile(std::shared_ptr<BlobFile> blob_file) {
|
|
|
|
const uint64_t blob_file_number = blob_file->BlobFileNumber();
|
|
|
|
|
|
|
|
auto it = blob_files_.lower_bound(blob_file_number);
|
|
|
|
assert(it == blob_files_.end() || it->first != blob_file_number);
|
|
|
|
|
|
|
|
blob_files_.insert(it,
|
|
|
|
std::map<uint64_t, std::shared_ptr<BlobFile>>::value_type(
|
|
|
|
blob_file_number, std::move(blob_file)));
|
|
|
|
}
|
|
|
|
|
2017-05-10 23:54:35 +02:00
|
|
|
Status BlobDBImpl::CreateWriterLocked(const std::shared_ptr<BlobFile>& bfile) {
|
|
|
|
std::string fpath(bfile->PathName());
|
|
|
|
std::unique_ptr<WritableFile> wfile;
|
|
|
|
|
2017-08-04 22:09:56 +02:00
|
|
|
Status s = env_->ReopenWritableFile(fpath, &wfile, env_options_);
|
2017-05-10 23:54:35 +02:00
|
|
|
if (!s.ok()) {
|
2017-07-13 19:03:39 +02:00
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
|
|
|
"Failed to open blob file for write: %s status: '%s'"
|
|
|
|
" exists: '%s'",
|
|
|
|
fpath.c_str(), s.ToString().c_str(),
|
2017-07-28 08:16:18 +02:00
|
|
|
env_->FileExists(fpath).ToString().c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
|
|
|
std::unique_ptr<WritableFileWriter> fwriter;
|
Introduce a new storage specific Env API (#5761)
Summary:
The current Env API encompasses both storage/file operations, as well as OS related operations. Most of the APIs return a Status, which does not have enough metadata about an error, such as whether its retry-able or not, scope (i.e fault domain) of the error etc., that may be required in order to properly handle a storage error. The file APIs also do not provide enough control over the IO SLA, such as timeout, prioritization, hinting about placement and redundancy etc.
This PR separates out the file/storage APIs from Env into a new FileSystem class. The APIs are updated to return an IOStatus with metadata about the error, as well as to take an IOOptions structure as input in order to allow more control over the IO.
The user can set both ```options.env``` and ```options.file_system``` to specify that RocksDB should use the former for OS related operations and the latter for storage operations. Internally, a ```CompositeEnvWrapper``` has been introduced that inherits from ```Env``` and redirects individual methods to either an ```Env``` implementation or the ```FileSystem``` as appropriate. When options are sanitized during ```DB::Open```, ```options.env``` is replaced with a newly allocated ```CompositeEnvWrapper``` instance if both env and file_system have been specified. This way, the rest of the RocksDB code can continue to function as before.
This PR also ports PosixEnv to the new API by splitting it into two - PosixEnv and PosixFileSystem. PosixEnv is defined as a sub-class of CompositeEnvWrapper, and threading/time functions are overridden with Posix specific implementations in order to avoid an extra level of indirection.
The ```CompositeEnvWrapper``` translates ```IOStatus``` return code to ```Status```, and sets the severity to ```kSoftError``` if the io_status is retryable. The error handling code in RocksDB can then recover the DB automatically.
Pull Request resolved: https://github.com/facebook/rocksdb/pull/5761
Differential Revision: D18868376
Pulled By: anand1976
fbshipit-source-id: 39efe18a162ea746fabac6360ff529baba48486f
2019-12-13 23:47:08 +01:00
|
|
|
fwriter.reset(new WritableFileWriter(
|
|
|
|
NewLegacyWritableFileWrapper(std::move(wfile)), fpath, env_options_));
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
uint64_t boffset = bfile->GetFileSize();
|
|
|
|
if (debug_level_ >= 2 && boffset) {
|
2019-04-04 21:05:42 +02:00
|
|
|
ROCKS_LOG_DEBUG(db_options_.info_log,
|
|
|
|
"Open blob file: %s with offset: %" PRIu64, fpath.c_str(),
|
|
|
|
boffset);
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2020-07-07 02:10:41 +02:00
|
|
|
BlobLogWriter::ElemType et = BlobLogWriter::kEtNone;
|
2017-10-27 22:14:34 +02:00
|
|
|
if (bfile->file_size_ == BlobLogHeader::kSize) {
|
2020-07-07 02:10:41 +02:00
|
|
|
et = BlobLogWriter::kEtFileHdr;
|
2017-10-27 22:14:34 +02:00
|
|
|
} else if (bfile->file_size_ > BlobLogHeader::kSize) {
|
2020-07-07 02:10:41 +02:00
|
|
|
et = BlobLogWriter::kEtRecord;
|
2017-10-17 21:11:52 +02:00
|
|
|
} else if (bfile->file_size_) {
|
2017-07-13 19:03:39 +02:00
|
|
|
ROCKS_LOG_WARN(db_options_.info_log,
|
2019-04-04 21:05:42 +02:00
|
|
|
"Open blob file: %s with wrong size: %" PRIu64,
|
|
|
|
fpath.c_str(), boffset);
|
2017-05-10 23:54:35 +02:00
|
|
|
return Status::Corruption("Invalid blob file size");
|
|
|
|
}
|
|
|
|
|
2020-07-07 02:10:41 +02:00
|
|
|
bfile->log_writer_ = std::make_shared<BlobLogWriter>(
|
2017-11-28 20:42:28 +01:00
|
|
|
std::move(fwriter), env_, statistics_, bfile->file_number_,
|
|
|
|
bdb_options_.bytes_per_sync, db_options_.use_fsync, boffset);
|
2017-05-10 23:54:35 +02:00
|
|
|
bfile->log_writer_->last_elem_type_ = et;
|
|
|
|
|
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
|
|
|
std::shared_ptr<BlobFile> BlobDBImpl::FindBlobFileLocked(
|
2017-08-04 02:46:00 +02:00
|
|
|
uint64_t expiration) const {
|
2018-03-06 20:46:20 +01:00
|
|
|
if (open_ttl_files_.empty()) {
|
|
|
|
return nullptr;
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
std::shared_ptr<BlobFile> tmp = std::make_shared<BlobFile>();
|
2018-03-06 20:46:20 +01:00
|
|
|
tmp->SetHasTTL(true);
|
2017-10-27 22:14:34 +02:00
|
|
|
tmp->expiration_range_ = std::make_pair(expiration, 0);
|
2018-03-06 20:46:20 +01:00
|
|
|
tmp->file_number_ = std::numeric_limits<uint64_t>::max();
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2017-11-01 00:33:55 +01:00
|
|
|
auto citr = open_ttl_files_.equal_range(tmp);
|
|
|
|
if (citr.first == open_ttl_files_.end()) {
|
|
|
|
assert(citr.second == open_ttl_files_.end());
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2017-11-01 00:33:55 +01:00
|
|
|
std::shared_ptr<BlobFile> check = *(open_ttl_files_.rbegin());
|
2018-03-06 20:46:20 +01:00
|
|
|
return (check->expiration_range_.second <= expiration) ? nullptr : check;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
if (citr.first != citr.second) {
|
|
|
|
return *(citr.first);
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
auto finditr = citr.second;
|
2018-03-06 20:46:20 +01:00
|
|
|
if (finditr != open_ttl_files_.begin()) {
|
|
|
|
--finditr;
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
bool b2 = (*finditr)->expiration_range_.second <= expiration;
|
2017-10-27 22:14:34 +02:00
|
|
|
bool b1 = (*finditr)->expiration_range_.first > expiration;
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
return (b1 || b2) ? nullptr : (*finditr);
|
|
|
|
}
|
|
|
|
|
2018-10-24 00:01:36 +02:00
|
|
|
Status BlobDBImpl::CheckOrCreateWriterLocked(
|
|
|
|
const std::shared_ptr<BlobFile>& blob_file,
|
2020-07-07 02:10:41 +02:00
|
|
|
std::shared_ptr<BlobLogWriter>* writer) {
|
2018-10-24 00:01:36 +02:00
|
|
|
assert(writer != nullptr);
|
|
|
|
*writer = blob_file->GetWriter();
|
|
|
|
if (*writer != nullptr) {
|
|
|
|
return Status::OK();
|
|
|
|
}
|
|
|
|
Status s = CreateWriterLocked(blob_file);
|
|
|
|
if (s.ok()) {
|
|
|
|
*writer = blob_file->GetWriter();
|
|
|
|
}
|
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
Status BlobDBImpl::CreateBlobFileAndWriter(
|
|
|
|
bool has_ttl, const ExpirationRange& expiration_range,
|
|
|
|
const std::string& reason, std::shared_ptr<BlobFile>* blob_file,
|
2020-07-07 02:10:41 +02:00
|
|
|
std::shared_ptr<BlobLogWriter>* writer) {
|
2020-06-30 02:30:04 +02:00
|
|
|
TEST_SYNC_POINT("BlobDBImpl::CreateBlobFileAndWriter");
|
2019-11-26 22:16:39 +01:00
|
|
|
assert(has_ttl == (expiration_range.first || expiration_range.second));
|
|
|
|
assert(blob_file);
|
|
|
|
assert(writer);
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
*blob_file = NewBlobFile(has_ttl, expiration_range, reason);
|
|
|
|
assert(*blob_file);
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
// file not visible, hence no lock
|
2019-11-26 22:16:39 +01:00
|
|
|
Status s = CheckOrCreateWriterLocked(*blob_file, writer);
|
2018-10-24 00:01:36 +02:00
|
|
|
if (!s.ok()) {
|
2017-07-13 19:03:39 +02:00
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
2019-11-26 22:16:39 +01:00
|
|
|
"Failed to get writer for blob file: %s, error: %s",
|
2018-10-24 00:01:36 +02:00
|
|
|
(*blob_file)->PathName().c_str(), s.ToString().c_str());
|
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
assert(*writer);
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
s = (*writer)->WriteHeader((*blob_file)->header_);
|
2017-05-10 23:54:35 +02:00
|
|
|
if (!s.ok()) {
|
2017-07-13 19:03:39 +02:00
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
|
|
|
"Failed to write header to new blob file: %s"
|
|
|
|
" status: '%s'",
|
2018-10-24 00:01:36 +02:00
|
|
|
(*blob_file)->PathName().c_str(), s.ToString().c_str());
|
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
(*blob_file)->SetFileSize(BlobLogHeader::kSize);
|
2018-03-06 20:46:20 +01:00
|
|
|
total_blob_size_ += BlobLogHeader::kSize;
|
2019-11-26 22:16:39 +01:00
|
|
|
|
2018-10-24 00:01:36 +02:00
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
Status BlobDBImpl::SelectBlobFile(std::shared_ptr<BlobFile>* blob_file) {
|
|
|
|
assert(blob_file);
|
|
|
|
|
2017-05-10 23:54:35 +02:00
|
|
|
{
|
|
|
|
ReadLock rl(&mutex_);
|
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
if (open_non_ttl_file_) {
|
|
|
|
assert(!open_non_ttl_file_->Immutable());
|
|
|
|
*blob_file = open_non_ttl_file_;
|
|
|
|
return Status::OK();
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
// Check again
|
|
|
|
WriteLock wl(&mutex_);
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
if (open_non_ttl_file_) {
|
|
|
|
assert(!open_non_ttl_file_->Immutable());
|
|
|
|
*blob_file = open_non_ttl_file_;
|
|
|
|
return Status::OK();
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2020-07-07 02:10:41 +02:00
|
|
|
std::shared_ptr<BlobLogWriter> writer;
|
2019-11-26 22:16:39 +01:00
|
|
|
const Status s = CreateBlobFileAndWriter(
|
|
|
|
/* has_ttl */ false, ExpirationRange(),
|
|
|
|
/* reason */ "SelectBlobFile", blob_file, &writer);
|
2018-10-24 00:01:36 +02:00
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-12-13 19:11:03 +01:00
|
|
|
RegisterBlobFile(*blob_file);
|
2019-11-26 22:16:39 +01:00
|
|
|
open_non_ttl_file_ = *blob_file;
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
return s;
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
Status BlobDBImpl::SelectBlobFileTTL(uint64_t expiration,
|
|
|
|
std::shared_ptr<BlobFile>* blob_file) {
|
|
|
|
assert(blob_file);
|
|
|
|
assert(expiration != kNoExpiration);
|
|
|
|
|
|
|
|
{
|
|
|
|
ReadLock rl(&mutex_);
|
|
|
|
|
|
|
|
*blob_file = FindBlobFileLocked(expiration);
|
|
|
|
if (*blob_file != nullptr) {
|
|
|
|
assert(!(*blob_file)->Immutable());
|
2018-10-24 00:01:36 +02:00
|
|
|
return Status::OK();
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-26 22:16:39 +01:00
|
|
|
// Check again
|
|
|
|
WriteLock wl(&mutex_);
|
|
|
|
|
|
|
|
*blob_file = FindBlobFileLocked(expiration);
|
|
|
|
if (*blob_file != nullptr) {
|
|
|
|
assert(!(*blob_file)->Immutable());
|
|
|
|
return Status::OK();
|
|
|
|
}
|
|
|
|
|
|
|
|
const uint64_t exp_low =
|
|
|
|
(expiration / bdb_options_.ttl_range_secs) * bdb_options_.ttl_range_secs;
|
|
|
|
const uint64_t exp_high = exp_low + bdb_options_.ttl_range_secs;
|
|
|
|
const ExpirationRange expiration_range(exp_low, exp_high);
|
|
|
|
|
|
|
|
std::ostringstream oss;
|
|
|
|
oss << "SelectBlobFileTTL range: [" << exp_low << ',' << exp_high << ')';
|
|
|
|
|
2020-07-07 02:10:41 +02:00
|
|
|
std::shared_ptr<BlobLogWriter> writer;
|
2019-11-26 22:16:39 +01:00
|
|
|
const Status s =
|
|
|
|
CreateBlobFileAndWriter(/* has_ttl */ true, expiration_range,
|
|
|
|
/* reason */ oss.str(), blob_file, &writer);
|
2017-05-10 23:54:35 +02:00
|
|
|
if (!s.ok()) {
|
2018-10-24 00:01:36 +02:00
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-12-13 19:11:03 +01:00
|
|
|
RegisterBlobFile(*blob_file);
|
2018-10-24 00:01:36 +02:00
|
|
|
open_ttl_files_.insert(*blob_file);
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2018-10-24 00:01:36 +02:00
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
class BlobDBImpl::BlobInserter : public WriteBatch::Handler {
|
|
|
|
private:
|
|
|
|
const WriteOptions& options_;
|
|
|
|
BlobDBImpl* blob_db_impl_;
|
|
|
|
uint32_t default_cf_id_;
|
|
|
|
WriteBatch batch_;
|
2017-05-10 23:54:35 +02:00
|
|
|
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
public:
|
|
|
|
BlobInserter(const WriteOptions& options, BlobDBImpl* blob_db_impl,
|
2017-12-15 22:18:32 +01:00
|
|
|
uint32_t default_cf_id)
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
: options_(options),
|
|
|
|
blob_db_impl_(blob_db_impl),
|
2017-12-15 22:18:32 +01:00
|
|
|
default_cf_id_(default_cf_id) {}
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
|
|
|
|
WriteBatch* batch() { return &batch_; }
|
|
|
|
|
2019-02-14 22:52:47 +01:00
|
|
|
Status PutCF(uint32_t column_family_id, const Slice& key,
|
|
|
|
const Slice& value) override {
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
if (column_family_id != default_cf_id_) {
|
|
|
|
return Status::NotSupported(
|
|
|
|
"Blob DB doesn't support non-default column family.");
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
2018-08-23 19:04:10 +02:00
|
|
|
Status s = blob_db_impl_->PutBlobValue(options_, key, value, kNoExpiration,
|
|
|
|
&batch_);
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
return s;
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-02-14 22:52:47 +01:00
|
|
|
Status DeleteCF(uint32_t column_family_id, const Slice& key) override {
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
if (column_family_id != default_cf_id_) {
|
|
|
|
return Status::NotSupported(
|
|
|
|
"Blob DB doesn't support non-default column family.");
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
Status s = WriteBatchInternal::Delete(&batch_, column_family_id, key);
|
|
|
|
return s;
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
virtual Status DeleteRange(uint32_t column_family_id, const Slice& begin_key,
|
|
|
|
const Slice& end_key) {
|
|
|
|
if (column_family_id != default_cf_id_) {
|
|
|
|
return Status::NotSupported(
|
|
|
|
"Blob DB doesn't support non-default column family.");
|
2017-09-08 19:57:12 +02:00
|
|
|
}
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
Status s = WriteBatchInternal::DeleteRange(&batch_, column_family_id,
|
|
|
|
begin_key, end_key);
|
|
|
|
return s;
|
|
|
|
}
|
2017-09-08 19:57:12 +02:00
|
|
|
|
2019-02-14 22:52:47 +01:00
|
|
|
Status SingleDeleteCF(uint32_t /*column_family_id*/,
|
|
|
|
const Slice& /*key*/) override {
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
return Status::NotSupported("Not supported operation in blob db.");
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-02-14 22:52:47 +01:00
|
|
|
Status MergeCF(uint32_t /*column_family_id*/, const Slice& /*key*/,
|
|
|
|
const Slice& /*value*/) override {
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
return Status::NotSupported("Not supported operation in blob db.");
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-02-14 22:52:47 +01:00
|
|
|
void LogData(const Slice& blob) override { batch_.PutLogData(blob); }
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
};
|
2017-05-10 23:54:35 +02:00
|
|
|
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
Status BlobDBImpl::Write(const WriteOptions& options, WriteBatch* updates) {
|
2017-11-28 20:42:28 +01:00
|
|
|
StopWatch write_sw(env_, statistics_, BLOB_DB_WRITE_MICROS);
|
|
|
|
RecordTick(statistics_, BLOB_DB_NUM_WRITE);
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
uint32_t default_cf_id =
|
2020-07-03 04:24:25 +02:00
|
|
|
static_cast_with_check<ColumnFamilyHandleImpl>(DefaultColumnFamily())
|
|
|
|
->GetID();
|
2017-11-09 04:33:12 +01:00
|
|
|
Status s;
|
2017-12-15 22:18:32 +01:00
|
|
|
BlobInserter blob_inserter(options, this, default_cf_id);
|
2017-11-09 04:33:12 +01:00
|
|
|
{
|
|
|
|
// Release write_mutex_ before DB write to avoid race condition with
|
|
|
|
// flush begin listener, which also require write_mutex_ to sync
|
|
|
|
// blob files.
|
|
|
|
MutexLock l(&write_mutex_);
|
|
|
|
s = updates->Iterate(&blob_inserter);
|
|
|
|
}
|
2017-10-17 21:11:52 +02:00
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
2018-03-02 21:54:24 +01:00
|
|
|
return db_->Write(options, blob_inserter.batch());
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
Status BlobDBImpl::Put(const WriteOptions& options, const Slice& key,
|
|
|
|
const Slice& value) {
|
2018-08-06 20:43:51 +02:00
|
|
|
return PutUntil(options, key, value, kNoExpiration);
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
}
|
|
|
|
|
2017-05-10 23:54:35 +02:00
|
|
|
Status BlobDBImpl::PutWithTTL(const WriteOptions& options,
|
|
|
|
const Slice& key, const Slice& value,
|
2017-08-04 02:46:00 +02:00
|
|
|
uint64_t ttl) {
|
|
|
|
uint64_t now = EpochNow();
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
uint64_t expiration = kNoExpiration - now > ttl ? now + ttl : kNoExpiration;
|
|
|
|
return PutUntil(options, key, value, expiration);
|
2017-06-14 22:44:36 +02:00
|
|
|
}
|
|
|
|
|
2017-09-08 19:57:12 +02:00
|
|
|
Status BlobDBImpl::PutUntil(const WriteOptions& options, const Slice& key,
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
const Slice& value, uint64_t expiration) {
|
2017-11-28 20:42:28 +01:00
|
|
|
StopWatch write_sw(env_, statistics_, BLOB_DB_WRITE_MICROS);
|
|
|
|
RecordTick(statistics_, BLOB_DB_NUM_PUT);
|
2017-11-09 04:33:12 +01:00
|
|
|
Status s;
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
WriteBatch batch;
|
2017-11-09 04:33:12 +01:00
|
|
|
{
|
|
|
|
// Release write_mutex_ before DB write to avoid race condition with
|
|
|
|
// flush begin listener, which also require write_mutex_ to sync
|
|
|
|
// blob files.
|
|
|
|
MutexLock l(&write_mutex_);
|
2017-12-15 22:18:32 +01:00
|
|
|
s = PutBlobValue(options, key, value, expiration, &batch);
|
2017-11-09 04:33:12 +01:00
|
|
|
}
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
if (s.ok()) {
|
|
|
|
s = db_->Write(options, &batch);
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
return s;
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2018-03-05 22:08:17 +01:00
|
|
|
Status BlobDBImpl::PutBlobValue(const WriteOptions& /*options*/,
|
|
|
|
const Slice& key, const Slice& value,
|
|
|
|
uint64_t expiration, WriteBatch* batch) {
|
2018-03-06 20:46:20 +01:00
|
|
|
write_mutex_.AssertHeld();
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
Status s;
|
|
|
|
std::string index_entry;
|
2017-10-18 02:24:25 +02:00
|
|
|
uint32_t column_family_id =
|
2020-07-03 04:24:25 +02:00
|
|
|
static_cast_with_check<ColumnFamilyHandleImpl>(DefaultColumnFamily())
|
|
|
|
->GetID();
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
if (value.size() < bdb_options_.min_blob_size) {
|
|
|
|
if (expiration == kNoExpiration) {
|
|
|
|
// Put as normal value
|
|
|
|
s = batch->Put(key, value);
|
2017-11-28 20:42:28 +01:00
|
|
|
RecordTick(statistics_, BLOB_DB_WRITE_INLINED);
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
} else {
|
|
|
|
// Inlined with TTL
|
|
|
|
BlobIndex::EncodeInlinedTTL(&index_entry, expiration, value);
|
|
|
|
s = WriteBatchInternal::PutBlobIndex(batch, column_family_id, key,
|
|
|
|
index_entry);
|
2017-11-28 20:42:28 +01:00
|
|
|
RecordTick(statistics_, BLOB_DB_WRITE_INLINED_TTL);
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
}
|
|
|
|
} else {
|
|
|
|
std::string compression_output;
|
|
|
|
Slice value_compressed = GetCompressedSlice(value, &compression_output);
|
2017-05-10 23:54:35 +02:00
|
|
|
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
std::string headerbuf;
|
2020-07-07 02:10:41 +02:00
|
|
|
BlobLogWriter::ConstructBlobHeader(&headerbuf, key, value_compressed,
|
|
|
|
expiration);
|
2017-10-18 02:24:25 +02:00
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
// Check DB size limit before selecting blob file to
|
|
|
|
// Since CheckSizeAndEvictBlobFiles() can close blob files, it needs to be
|
|
|
|
// done before calling SelectBlobFile().
|
|
|
|
s = CheckSizeAndEvictBlobFiles(headerbuf.size() + key.size() +
|
|
|
|
value_compressed.size());
|
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
2018-10-24 00:01:36 +02:00
|
|
|
std::shared_ptr<BlobFile> blob_file;
|
|
|
|
if (expiration != kNoExpiration) {
|
|
|
|
s = SelectBlobFileTTL(expiration, &blob_file);
|
2017-11-28 20:42:28 +01:00
|
|
|
} else {
|
2018-10-24 00:01:36 +02:00
|
|
|
s = SelectBlobFile(&blob_file);
|
|
|
|
}
|
|
|
|
if (s.ok()) {
|
|
|
|
assert(blob_file != nullptr);
|
2019-11-27 22:07:28 +01:00
|
|
|
assert(blob_file->GetCompressionType() == bdb_options_.compression);
|
2018-10-24 00:01:36 +02:00
|
|
|
s = AppendBlob(blob_file, headerbuf, key, value_compressed, expiration,
|
|
|
|
&index_entry);
|
2017-11-28 20:42:28 +01:00
|
|
|
}
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
if (s.ok()) {
|
|
|
|
if (expiration != kNoExpiration) {
|
2019-08-15 01:07:03 +02:00
|
|
|
WriteLock file_lock(&blob_file->mutex_);
|
2018-10-24 00:01:36 +02:00
|
|
|
blob_file->ExtendExpirationRange(expiration);
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
}
|
2018-10-24 00:01:36 +02:00
|
|
|
s = CloseBlobFileIfNeeded(blob_file);
|
|
|
|
}
|
|
|
|
if (s.ok()) {
|
|
|
|
s = WriteBatchInternal::PutBlobIndex(batch, column_family_id, key,
|
|
|
|
index_entry);
|
|
|
|
}
|
|
|
|
if (s.ok()) {
|
|
|
|
if (expiration == kNoExpiration) {
|
|
|
|
RecordTick(statistics_, BLOB_DB_WRITE_BLOB);
|
|
|
|
} else {
|
|
|
|
RecordTick(statistics_, BLOB_DB_WRITE_BLOB_TTL);
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
}
|
|
|
|
} else {
|
2019-04-04 21:05:42 +02:00
|
|
|
ROCKS_LOG_ERROR(
|
|
|
|
db_options_.info_log,
|
|
|
|
"Failed to append blob to FILE: %s: KEY: %s VALSZ: %" ROCKSDB_PRIszt
|
|
|
|
" status: '%s' blob_file: '%s'",
|
|
|
|
blob_file->PathName().c_str(), key.ToString().c_str(), value.size(),
|
|
|
|
s.ToString().c_str(), blob_file->DumpState().c_str());
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
}
|
2017-08-25 19:40:25 +02:00
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2017-11-28 20:42:28 +01:00
|
|
|
RecordTick(statistics_, BLOB_DB_NUM_KEYS_WRITTEN);
|
|
|
|
RecordTick(statistics_, BLOB_DB_BYTES_WRITTEN, key.size() + value.size());
|
2019-02-28 19:14:19 +01:00
|
|
|
RecordInHistogram(statistics_, BLOB_DB_KEY_SIZE, key.size());
|
|
|
|
RecordInHistogram(statistics_, BLOB_DB_VALUE_SIZE, value.size());
|
2017-11-28 20:42:28 +01:00
|
|
|
|
2017-05-10 23:54:35 +02:00
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
Slice BlobDBImpl::GetCompressedSlice(const Slice& raw,
|
|
|
|
std::string* compression_output) const {
|
|
|
|
if (bdb_options_.compression == kNoCompression) {
|
|
|
|
return raw;
|
|
|
|
}
|
2017-11-28 20:42:28 +01:00
|
|
|
StopWatch compression_sw(env_, statistics_, BLOB_DB_COMPRESSION_MICROS);
|
2019-01-19 04:10:17 +01:00
|
|
|
CompressionType type = bdb_options_.compression;
|
|
|
|
CompressionOptions opts;
|
|
|
|
CompressionContext context(type);
|
2019-03-18 20:07:35 +01:00
|
|
|
CompressionInfo info(opts, context, CompressionDict::GetEmptyDict(), type,
|
|
|
|
0 /* sample_for_compression */);
|
|
|
|
CompressBlock(raw, info, &type, kBlockBasedTableVersionFormat, false,
|
|
|
|
compression_output, nullptr, nullptr);
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
return *compression_output;
|
|
|
|
}
|
|
|
|
|
2020-06-30 02:30:04 +02:00
|
|
|
Status BlobDBImpl::DecompressSlice(const Slice& compressed_value,
|
|
|
|
CompressionType compression_type,
|
|
|
|
PinnableSlice* value_output) const {
|
|
|
|
if (compression_type != kNoCompression) {
|
|
|
|
BlockContents contents;
|
|
|
|
auto cfh = static_cast<ColumnFamilyHandleImpl*>(DefaultColumnFamily());
|
|
|
|
|
|
|
|
{
|
|
|
|
StopWatch decompression_sw(env_, statistics_,
|
|
|
|
BLOB_DB_DECOMPRESSION_MICROS);
|
|
|
|
UncompressionContext context(compression_type);
|
|
|
|
UncompressionInfo info(context, UncompressionDict::GetEmptyDict(),
|
|
|
|
compression_type);
|
|
|
|
Status s = UncompressBlockContentsForCompressionType(
|
|
|
|
info, compressed_value.data(), compressed_value.size(), &contents,
|
|
|
|
kBlockBasedTableVersionFormat, *(cfh->cfd()->ioptions()));
|
|
|
|
if (!s.ok()) {
|
|
|
|
return Status::Corruption("Unable to decompress blob.");
|
|
|
|
}
|
|
|
|
}
|
|
|
|
value_output->PinSelf(contents.data);
|
|
|
|
}
|
|
|
|
return Status::OK();
|
|
|
|
}
|
|
|
|
|
2019-11-11 23:00:25 +01:00
|
|
|
Status BlobDBImpl::CompactFiles(
|
|
|
|
const CompactionOptions& compact_options,
|
|
|
|
const std::vector<std::string>& input_file_names, const int output_level,
|
|
|
|
const int output_path_id, std::vector<std::string>* const output_file_names,
|
|
|
|
CompactionJobInfo* compaction_job_info) {
|
|
|
|
// Note: we need CompactionJobInfo to be able to track updates to the
|
|
|
|
// blob file <-> SST mappings, so we provide one if the user hasn't,
|
|
|
|
// assuming that GC is enabled.
|
|
|
|
CompactionJobInfo info{};
|
|
|
|
if (bdb_options_.enable_garbage_collection && !compaction_job_info) {
|
|
|
|
compaction_job_info = &info;
|
|
|
|
}
|
|
|
|
|
|
|
|
const Status s =
|
|
|
|
db_->CompactFiles(compact_options, input_file_names, output_level,
|
|
|
|
output_path_id, output_file_names, compaction_job_info);
|
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (bdb_options_.enable_garbage_collection) {
|
|
|
|
assert(compaction_job_info);
|
|
|
|
ProcessCompactionJobInfo(*compaction_job_info);
|
|
|
|
}
|
|
|
|
|
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
2020-06-30 02:30:04 +02:00
|
|
|
void BlobDBImpl::GetCompactionContextCommon(BlobCompactionContext* context) {
|
2019-12-13 19:11:03 +01:00
|
|
|
assert(context);
|
2018-03-06 20:46:20 +01:00
|
|
|
|
2020-06-30 02:30:04 +02:00
|
|
|
context->blob_db_impl = this;
|
2018-03-06 20:46:20 +01:00
|
|
|
context->next_file_number = next_file_number_.load();
|
|
|
|
context->current_blob_files.clear();
|
|
|
|
for (auto& p : blob_files_) {
|
|
|
|
context->current_blob_files.insert(p.first);
|
2018-01-20 01:19:34 +01:00
|
|
|
}
|
2018-03-06 20:46:20 +01:00
|
|
|
context->fifo_eviction_seq = fifo_eviction_seq_;
|
|
|
|
context->evict_expiration_up_to = evict_expiration_up_to_;
|
2017-11-02 20:02:42 +01:00
|
|
|
}
|
|
|
|
|
2019-12-13 19:11:03 +01:00
|
|
|
void BlobDBImpl::GetCompactionContext(BlobCompactionContext* context) {
|
|
|
|
assert(context);
|
|
|
|
|
|
|
|
ReadLock l(&mutex_);
|
|
|
|
GetCompactionContextCommon(context);
|
|
|
|
}
|
|
|
|
|
|
|
|
void BlobDBImpl::GetCompactionContext(BlobCompactionContext* context,
|
|
|
|
BlobCompactionContextGC* context_gc) {
|
|
|
|
assert(context);
|
|
|
|
assert(context_gc);
|
|
|
|
|
|
|
|
ReadLock l(&mutex_);
|
|
|
|
GetCompactionContextCommon(context);
|
|
|
|
|
|
|
|
if (!live_imm_non_ttl_blob_files_.empty()) {
|
|
|
|
auto it = live_imm_non_ttl_blob_files_.begin();
|
|
|
|
std::advance(it, bdb_options_.garbage_collection_cutoff *
|
|
|
|
live_imm_non_ttl_blob_files_.size());
|
|
|
|
context_gc->cutoff_file_number = it != live_imm_non_ttl_blob_files_.end()
|
|
|
|
? it->first
|
|
|
|
: std::numeric_limits<uint64_t>::max();
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
void BlobDBImpl::UpdateLiveSSTSize() {
|
|
|
|
uint64_t live_sst_size = 0;
|
|
|
|
bool ok = GetIntProperty(DB::Properties::kLiveSstFilesSize, &live_sst_size);
|
|
|
|
if (ok) {
|
|
|
|
live_sst_size_.store(live_sst_size);
|
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"Updated total SST file size: %" PRIu64 " bytes.",
|
|
|
|
live_sst_size);
|
|
|
|
} else {
|
|
|
|
ROCKS_LOG_ERROR(
|
|
|
|
db_options_.info_log,
|
|
|
|
"Failed to update total SST file size after flush or compaction.");
|
2017-11-02 20:02:42 +01:00
|
|
|
}
|
2018-03-06 20:46:20 +01:00
|
|
|
{
|
|
|
|
// Trigger FIFO eviction if needed.
|
|
|
|
MutexLock l(&write_mutex_);
|
|
|
|
Status s = CheckSizeAndEvictBlobFiles(0, true /*force*/);
|
|
|
|
if (s.IsNoSpace()) {
|
|
|
|
ROCKS_LOG_WARN(db_options_.info_log,
|
|
|
|
"DB grow out-of-space after SST size updated. Current live"
|
|
|
|
" SST size: %" PRIu64
|
|
|
|
" , current blob files size: %" PRIu64 ".",
|
|
|
|
live_sst_size_.load(), total_blob_size_.load());
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
2017-11-02 20:02:42 +01:00
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
Status BlobDBImpl::CheckSizeAndEvictBlobFiles(uint64_t blob_size,
|
|
|
|
bool force_evict) {
|
|
|
|
write_mutex_.AssertHeld();
|
|
|
|
|
|
|
|
uint64_t live_sst_size = live_sst_size_.load();
|
|
|
|
if (bdb_options_.max_db_size == 0 ||
|
|
|
|
live_sst_size + total_blob_size_.load() + blob_size <=
|
|
|
|
bdb_options_.max_db_size) {
|
|
|
|
return Status::OK();
|
|
|
|
}
|
|
|
|
|
|
|
|
if (bdb_options_.is_fifo == false ||
|
|
|
|
(!force_evict && live_sst_size + blob_size > bdb_options_.max_db_size)) {
|
|
|
|
// FIFO eviction is disabled, or no space to insert new blob even we evict
|
|
|
|
// all blob files.
|
|
|
|
return Status::NoSpace(
|
|
|
|
"Write failed, as writing it would exceed max_db_size limit.");
|
|
|
|
}
|
|
|
|
|
|
|
|
std::vector<std::shared_ptr<BlobFile>> candidate_files;
|
2018-06-26 07:32:29 +02:00
|
|
|
CopyBlobFiles(&candidate_files);
|
2018-03-06 20:46:20 +01:00
|
|
|
std::sort(candidate_files.begin(), candidate_files.end(),
|
2018-06-26 07:32:29 +02:00
|
|
|
BlobFileComparator());
|
2018-03-06 20:46:20 +01:00
|
|
|
fifo_eviction_seq_ = GetLatestSequenceNumber();
|
|
|
|
|
|
|
|
WriteLock l(&mutex_);
|
|
|
|
|
|
|
|
while (!candidate_files.empty() &&
|
|
|
|
live_sst_size + total_blob_size_.load() + blob_size >
|
|
|
|
bdb_options_.max_db_size) {
|
|
|
|
std::shared_ptr<BlobFile> blob_file = candidate_files.back();
|
|
|
|
candidate_files.pop_back();
|
|
|
|
WriteLock file_lock(&blob_file->mutex_);
|
|
|
|
if (blob_file->Obsolete()) {
|
|
|
|
// File already obsoleted by someone else.
|
2019-11-19 01:28:04 +01:00
|
|
|
assert(blob_file->Immutable());
|
2018-03-06 20:46:20 +01:00
|
|
|
continue;
|
|
|
|
}
|
|
|
|
// FIFO eviction can evict open blob files.
|
|
|
|
if (!blob_file->Immutable()) {
|
2019-11-19 01:28:04 +01:00
|
|
|
Status s = CloseBlobFile(blob_file);
|
2018-03-06 20:46:20 +01:00
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
assert(blob_file->Immutable());
|
|
|
|
auto expiration_range = blob_file->GetExpirationRange();
|
2017-11-02 23:50:30 +01:00
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"Evict oldest blob file since DB out of space. Current "
|
2018-03-06 20:46:20 +01:00
|
|
|
"live SST file size: %" PRIu64 ", total blob size: %" PRIu64
|
|
|
|
", max db size: %" PRIu64 ", evicted blob file #%" PRIu64
|
2018-06-26 07:32:29 +02:00
|
|
|
".",
|
2018-03-06 20:46:20 +01:00
|
|
|
live_sst_size, total_blob_size_.load(),
|
2018-06-26 07:32:29 +02:00
|
|
|
bdb_options_.max_db_size, blob_file->BlobFileNumber());
|
2018-03-06 20:46:20 +01:00
|
|
|
ObsoleteBlobFile(blob_file, fifo_eviction_seq_, true /*update_size*/);
|
|
|
|
evict_expiration_up_to_ = expiration_range.first;
|
2017-11-28 20:42:28 +01:00
|
|
|
RecordTick(statistics_, BLOB_DB_FIFO_NUM_FILES_EVICTED);
|
|
|
|
RecordTick(statistics_, BLOB_DB_FIFO_NUM_KEYS_EVICTED,
|
2018-03-06 20:46:20 +01:00
|
|
|
blob_file->BlobCount());
|
2017-11-28 20:42:28 +01:00
|
|
|
RecordTick(statistics_, BLOB_DB_FIFO_BYTES_EVICTED,
|
2018-03-06 20:46:20 +01:00
|
|
|
blob_file->GetFileSize());
|
2018-01-20 01:19:34 +01:00
|
|
|
TEST_SYNC_POINT("BlobDBImpl::EvictOldestBlobFile:Evicted");
|
2017-11-02 23:50:30 +01:00
|
|
|
}
|
2018-03-06 20:46:20 +01:00
|
|
|
if (live_sst_size + total_blob_size_.load() + blob_size >
|
|
|
|
bdb_options_.max_db_size) {
|
|
|
|
return Status::NoSpace(
|
|
|
|
"Write failed, as writing it would exceed max_db_size limit.");
|
2017-11-02 20:02:42 +01:00
|
|
|
}
|
|
|
|
return Status::OK();
|
|
|
|
}
|
|
|
|
|
2017-05-10 23:54:35 +02:00
|
|
|
Status BlobDBImpl::AppendBlob(const std::shared_ptr<BlobFile>& bfile,
|
|
|
|
const std::string& headerbuf, const Slice& key,
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
const Slice& value, uint64_t expiration,
|
|
|
|
std::string* index_entry) {
|
2018-03-06 20:46:20 +01:00
|
|
|
Status s;
|
2017-05-10 23:54:35 +02:00
|
|
|
uint64_t blob_offset = 0;
|
|
|
|
uint64_t key_offset = 0;
|
|
|
|
{
|
|
|
|
WriteLock lockbfile_w(&bfile->mutex_);
|
2020-07-07 02:10:41 +02:00
|
|
|
std::shared_ptr<BlobLogWriter> writer;
|
2018-10-24 00:01:36 +02:00
|
|
|
s = CheckOrCreateWriterLocked(bfile, &writer);
|
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
2018-03-06 20:46:20 +01:00
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
// write the blob to the blob log.
|
|
|
|
s = writer->EmitPhysicalRecord(headerbuf, key, value, &key_offset,
|
|
|
|
&blob_offset);
|
|
|
|
}
|
|
|
|
|
|
|
|
if (!s.ok()) {
|
2017-07-13 19:03:39 +02:00
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
|
|
|
"Invalid status in AppendBlob: %s status: '%s'",
|
|
|
|
bfile->PathName().c_str(), s.ToString().c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
uint64_t size_put = headerbuf.size() + key.size() + value.size();
|
2019-12-13 19:11:03 +01:00
|
|
|
bfile->BlobRecordAdded(size_put);
|
2018-03-06 20:46:20 +01:00
|
|
|
total_blob_size_ += size_put;
|
2017-05-10 23:54:35 +02:00
|
|
|
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
if (expiration == kNoExpiration) {
|
|
|
|
BlobIndex::EncodeBlob(index_entry, bfile->BlobFileNumber(), blob_offset,
|
|
|
|
value.size(), bdb_options_.compression);
|
|
|
|
} else {
|
|
|
|
BlobIndex::EncodeBlobTTL(index_entry, expiration, bfile->BlobFileNumber(),
|
|
|
|
blob_offset, value.size(),
|
|
|
|
bdb_options_.compression);
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
|
|
|
std::vector<Status> BlobDBImpl::MultiGet(
|
2017-08-21 03:12:38 +02:00
|
|
|
const ReadOptions& read_options,
|
2017-05-10 23:54:35 +02:00
|
|
|
const std::vector<Slice>& keys, std::vector<std::string>* values) {
|
2017-11-28 20:42:28 +01:00
|
|
|
StopWatch multiget_sw(env_, statistics_, BLOB_DB_MULTIGET_MICROS);
|
|
|
|
RecordTick(statistics_, BLOB_DB_NUM_MULTIGET);
|
2017-08-21 03:12:38 +02:00
|
|
|
// Get a snapshot to avoid blob file get deleted between we
|
|
|
|
// fetch and index entry and reading from the file.
|
|
|
|
ReadOptions ro(read_options);
|
|
|
|
bool snapshot_created = SetSnapshotIfNeeded(&ro);
|
2017-10-18 02:24:25 +02:00
|
|
|
|
|
|
|
std::vector<Status> statuses;
|
|
|
|
statuses.reserve(keys.size());
|
|
|
|
values->clear();
|
|
|
|
values->reserve(keys.size());
|
|
|
|
PinnableSlice value;
|
|
|
|
for (size_t i = 0; i < keys.size(); i++) {
|
|
|
|
statuses.push_back(Get(ro, DefaultColumnFamily(), keys[i], &value));
|
|
|
|
values->push_back(value.ToString());
|
|
|
|
value.Reset();
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
2017-08-21 03:12:38 +02:00
|
|
|
if (snapshot_created) {
|
|
|
|
db_->ReleaseSnapshot(ro.snapshot);
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
return statuses;
|
|
|
|
}
|
|
|
|
|
2017-08-21 03:12:38 +02:00
|
|
|
bool BlobDBImpl::SetSnapshotIfNeeded(ReadOptions* read_options) {
|
|
|
|
assert(read_options != nullptr);
|
|
|
|
if (read_options->snapshot != nullptr) {
|
|
|
|
return false;
|
|
|
|
}
|
|
|
|
read_options->snapshot = db_->GetSnapshot();
|
|
|
|
return true;
|
|
|
|
}
|
|
|
|
|
2017-10-18 02:24:25 +02:00
|
|
|
Status BlobDBImpl::GetBlobValue(const Slice& key, const Slice& index_entry,
|
2018-08-07 02:28:40 +02:00
|
|
|
PinnableSlice* value, uint64_t* expiration) {
|
2019-11-27 01:42:44 +01:00
|
|
|
assert(value);
|
|
|
|
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
BlobIndex blob_index;
|
|
|
|
Status s = blob_index.DecodeFrom(index_entry);
|
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
|
|
|
}
|
2019-11-27 01:42:44 +01:00
|
|
|
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
if (blob_index.HasTTL() && blob_index.expiration() <= EpochNow()) {
|
|
|
|
return Status::NotFound("Key expired");
|
|
|
|
}
|
2019-11-27 01:42:44 +01:00
|
|
|
|
2018-08-07 02:28:40 +02:00
|
|
|
if (expiration != nullptr) {
|
|
|
|
if (blob_index.HasTTL()) {
|
|
|
|
*expiration = blob_index.expiration();
|
|
|
|
} else {
|
|
|
|
*expiration = kNoExpiration;
|
|
|
|
}
|
|
|
|
}
|
2019-11-27 01:42:44 +01:00
|
|
|
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
if (blob_index.IsInlined()) {
|
|
|
|
// TODO(yiwu): If index_entry is a PinnableSlice, we can also pin the same
|
|
|
|
// memory buffer to avoid extra copy.
|
|
|
|
value->PinSelf(blob_index.value());
|
|
|
|
return Status::OK();
|
|
|
|
}
|
2019-11-27 01:42:44 +01:00
|
|
|
|
|
|
|
CompressionType compression_type = kNoCompression;
|
|
|
|
s = GetRawBlobFromFile(key, blob_index.file_number(), blob_index.offset(),
|
|
|
|
blob_index.size(), value, &compression_type);
|
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (compression_type != kNoCompression) {
|
2020-06-30 02:30:04 +02:00
|
|
|
s = DecompressSlice(*value, compression_type, value);
|
2019-11-27 01:42:44 +01:00
|
|
|
if (!s.ok()) {
|
|
|
|
if (debug_level_ >= 2) {
|
|
|
|
ROCKS_LOG_ERROR(
|
|
|
|
db_options_.info_log,
|
|
|
|
"Uncompression error during blob read from file: %" PRIu64
|
|
|
|
" blob_offset: %" PRIu64 " blob_size: %" PRIu64
|
|
|
|
" key: %s status: '%s'",
|
|
|
|
blob_index.file_number(), blob_index.offset(), blob_index.size(),
|
|
|
|
key.ToString(/* output_hex */ true).c_str(), s.ToString().c_str());
|
|
|
|
}
|
2020-06-30 02:30:04 +02:00
|
|
|
return s;
|
2019-11-27 01:42:44 +01:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
return Status::OK();
|
|
|
|
}
|
|
|
|
|
|
|
|
Status BlobDBImpl::GetRawBlobFromFile(const Slice& key, uint64_t file_number,
|
|
|
|
uint64_t offset, uint64_t size,
|
|
|
|
PinnableSlice* value,
|
|
|
|
CompressionType* compression_type) {
|
|
|
|
assert(value);
|
|
|
|
assert(compression_type);
|
|
|
|
assert(*compression_type == kNoCompression);
|
|
|
|
|
|
|
|
if (!size) {
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
value->PinSelf("");
|
|
|
|
return Status::OK();
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
// offset has to have certain min, as we will read CRC
|
|
|
|
// later from the Blob Header, which needs to be also a
|
|
|
|
// valid offset.
|
2019-11-27 01:42:44 +01:00
|
|
|
if (offset <
|
2017-10-27 22:14:34 +02:00
|
|
|
(BlobLogHeader::kSize + BlobLogRecord::kHeaderSize + key.size())) {
|
2017-05-10 23:54:35 +02:00
|
|
|
if (debug_level_ >= 2) {
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
|
|
|
"Invalid blob index file_number: %" PRIu64
|
|
|
|
" blob_offset: %" PRIu64 " blob_size: %" PRIu64
|
|
|
|
" key: %s",
|
2019-11-27 01:42:44 +01:00
|
|
|
file_number, offset, size,
|
|
|
|
key.ToString(/* output_hex */ true).c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
2019-11-27 01:42:44 +01:00
|
|
|
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
return Status::NotFound("Invalid blob offset");
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-27 01:42:44 +01:00
|
|
|
std::shared_ptr<BlobFile> blob_file;
|
|
|
|
|
2017-05-10 23:54:35 +02:00
|
|
|
{
|
|
|
|
ReadLock rl(&mutex_);
|
2019-11-27 01:42:44 +01:00
|
|
|
auto it = blob_files_.find(file_number);
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
// file was deleted
|
2019-11-27 01:42:44 +01:00
|
|
|
if (it == blob_files_.end()) {
|
2017-05-10 23:54:35 +02:00
|
|
|
return Status::NotFound("Blob Not Found as blob file missing");
|
|
|
|
}
|
|
|
|
|
2019-11-27 01:42:44 +01:00
|
|
|
blob_file = it->second;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-27 22:07:28 +01:00
|
|
|
*compression_type = blob_file->GetCompressionType();
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
// takes locks when called
|
2018-09-21 01:50:07 +02:00
|
|
|
std::shared_ptr<RandomAccessFileReader> reader;
|
2019-11-27 01:42:44 +01:00
|
|
|
Status s = GetBlobFileReader(blob_file, &reader);
|
2018-09-21 01:50:07 +02:00
|
|
|
if (!s.ok()) {
|
|
|
|
return s;
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-11-27 01:42:44 +01:00
|
|
|
assert(offset >= key.size() + sizeof(uint32_t));
|
|
|
|
const uint64_t record_offset = offset - key.size() - sizeof(uint32_t);
|
|
|
|
const uint64_t record_size = sizeof(uint32_t) + key.size() + size;
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2017-10-27 22:14:34 +02:00
|
|
|
// Allocate the buffer. This is safe in C++11
|
2020-03-06 23:02:09 +01:00
|
|
|
std::string buf;
|
Support direct IO in RandomAccessFileReader::MultiRead (#6446)
Summary:
By supporting direct IO in RandomAccessFileReader::MultiRead, the benefits of parallel IO (IO uring) and direct IO can be combined.
In direct IO mode, read requests are aligned and merged together before being issued to RandomAccessFile::MultiRead, so blocks in the original requests might share the same underlying buffer, the shared buffers are returned in `aligned_bufs`, which is a new parameter of the `MultiRead` API.
For example, suppose alignment requirement for direct IO is 4KB, one request is (offset: 1KB, len: 1KB), another request is (offset: 3KB, len: 1KB), then since they all belong to page (offset: 0, len: 4KB), `MultiRead` only reads the page with direct IO into a buffer on heap, and returns 2 Slices referencing regions in that same buffer. See `random_access_file_reader_test.cc` for more examples.
Pull Request resolved: https://github.com/facebook/rocksdb/pull/6446
Test Plan: Added a new test `random_access_file_reader_test.cc`.
Reviewed By: anand1976
Differential Revision: D20097518
Pulled By: cheng-chang
fbshipit-source-id: ca48a8faf9c3af146465c102ef6b266a363e78d1
2020-03-21 00:15:40 +01:00
|
|
|
AlignedBuf aligned_buf;
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2018-01-06 01:35:49 +01:00
|
|
|
// A partial blob record contain checksum, key and value.
|
|
|
|
Slice blob_record;
|
2019-11-27 01:42:44 +01:00
|
|
|
|
2017-11-28 20:42:28 +01:00
|
|
|
{
|
|
|
|
StopWatch read_sw(env_, statistics_, BLOB_DB_BLOB_FILE_READ_MICROS);
|
2020-03-06 23:02:09 +01:00
|
|
|
if (reader->use_direct_io()) {
|
2020-04-30 23:48:51 +02:00
|
|
|
s = reader->Read(IOOptions(), record_offset,
|
|
|
|
static_cast<size_t>(record_size), &blob_record, nullptr,
|
|
|
|
&aligned_buf);
|
2020-03-06 23:02:09 +01:00
|
|
|
} else {
|
|
|
|
buf.reserve(static_cast<size_t>(record_size));
|
2020-04-30 23:48:51 +02:00
|
|
|
s = reader->Read(IOOptions(), record_offset,
|
|
|
|
static_cast<size_t>(record_size), &blob_record, &buf[0],
|
|
|
|
nullptr);
|
2020-03-06 23:02:09 +01:00
|
|
|
}
|
2018-01-06 01:35:49 +01:00
|
|
|
RecordTick(statistics_, BLOB_DB_BLOB_FILE_BYTES_READ, blob_record.size());
|
2017-11-28 20:42:28 +01:00
|
|
|
}
|
2019-11-27 01:42:44 +01:00
|
|
|
|
2018-01-06 01:35:49 +01:00
|
|
|
if (!s.ok()) {
|
2019-11-27 01:42:44 +01:00
|
|
|
ROCKS_LOG_DEBUG(
|
|
|
|
db_options_.info_log,
|
|
|
|
"Failed to read blob from blob file %" PRIu64 ", blob_offset: %" PRIu64
|
|
|
|
", blob_size: %" PRIu64 ", key_size: %" ROCKSDB_PRIszt ", status: '%s'",
|
|
|
|
file_number, offset, size, key.size(), s.ToString().c_str());
|
2018-01-06 01:35:49 +01:00
|
|
|
return s;
|
2017-10-17 21:11:52 +02:00
|
|
|
}
|
2019-11-27 01:42:44 +01:00
|
|
|
|
2018-01-06 01:35:49 +01:00
|
|
|
if (blob_record.size() != record_size) {
|
2019-04-04 21:05:42 +02:00
|
|
|
ROCKS_LOG_DEBUG(
|
|
|
|
db_options_.info_log,
|
|
|
|
"Failed to read blob from blob file %" PRIu64 ", blob_offset: %" PRIu64
|
|
|
|
", blob_size: %" PRIu64 ", key_size: %" ROCKSDB_PRIszt
|
|
|
|
", read %" ROCKSDB_PRIszt " bytes, expected %" PRIu64 " bytes",
|
2019-11-27 01:42:44 +01:00
|
|
|
file_number, offset, size, key.size(), blob_record.size(), record_size);
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2018-01-06 01:35:49 +01:00
|
|
|
return Status::Corruption("Failed to retrieve blob from blob index.");
|
2017-10-17 21:11:52 +02:00
|
|
|
}
|
2019-11-27 01:42:44 +01:00
|
|
|
|
2018-01-06 01:35:49 +01:00
|
|
|
Slice crc_slice(blob_record.data(), sizeof(uint32_t));
|
|
|
|
Slice blob_value(blob_record.data() + sizeof(uint32_t) + key.size(),
|
2019-11-27 01:42:44 +01:00
|
|
|
static_cast<size_t>(size));
|
|
|
|
|
|
|
|
uint32_t crc_exp = 0;
|
2018-01-06 01:35:49 +01:00
|
|
|
if (!GetFixed32(&crc_slice, &crc_exp)) {
|
2019-11-27 01:42:44 +01:00
|
|
|
ROCKS_LOG_DEBUG(
|
|
|
|
db_options_.info_log,
|
|
|
|
"Unable to decode CRC from blob file %" PRIu64 ", blob_offset: %" PRIu64
|
|
|
|
", blob_size: %" PRIu64 ", key size: %" ROCKSDB_PRIszt ", status: '%s'",
|
|
|
|
file_number, offset, size, key.size(), s.ToString().c_str());
|
2018-01-06 01:35:49 +01:00
|
|
|
return Status::Corruption("Unable to decode checksum.");
|
|
|
|
}
|
|
|
|
|
|
|
|
uint32_t crc = crc32c::Value(blob_record.data() + sizeof(uint32_t),
|
|
|
|
blob_record.size() - sizeof(uint32_t));
|
2017-10-17 21:11:52 +02:00
|
|
|
crc = crc32c::Mask(crc); // Adjust for storage
|
|
|
|
if (crc != crc_exp) {
|
|
|
|
if (debug_level_ >= 2) {
|
2019-11-27 01:42:44 +01:00
|
|
|
ROCKS_LOG_ERROR(
|
|
|
|
db_options_.info_log,
|
|
|
|
"Blob crc mismatch file: %" PRIu64 " blob_offset: %" PRIu64
|
|
|
|
" blob_size: %" PRIu64 " key: %s status: '%s'",
|
|
|
|
file_number, offset, size,
|
|
|
|
key.ToString(/* output_hex */ true).c_str(), s.ToString().c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
2019-11-27 01:42:44 +01:00
|
|
|
|
2017-10-17 21:11:52 +02:00
|
|
|
return Status::Corruption("Corruption. Blob CRC mismatch");
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-27 01:42:44 +01:00
|
|
|
value->PinSelf(blob_value);
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-11-27 01:42:44 +01:00
|
|
|
return Status::OK();
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2017-08-21 03:12:38 +02:00
|
|
|
Status BlobDBImpl::Get(const ReadOptions& read_options,
|
2017-05-10 23:54:35 +02:00
|
|
|
ColumnFamilyHandle* column_family, const Slice& key,
|
2017-07-13 02:56:40 +02:00
|
|
|
PinnableSlice* value) {
|
2020-03-03 00:58:32 +01:00
|
|
|
return Get(read_options, column_family, key, value,
|
|
|
|
static_cast<uint64_t*>(nullptr) /*expiration*/);
|
2018-08-07 02:28:40 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
Status BlobDBImpl::Get(const ReadOptions& read_options,
|
|
|
|
ColumnFamilyHandle* column_family, const Slice& key,
|
|
|
|
PinnableSlice* value, uint64_t* expiration) {
|
2017-11-28 20:42:28 +01:00
|
|
|
StopWatch get_sw(env_, statistics_, BLOB_DB_GET_MICROS);
|
|
|
|
RecordTick(statistics_, BLOB_DB_NUM_GET);
|
2018-08-07 02:28:40 +02:00
|
|
|
return GetImpl(read_options, column_family, key, value, expiration);
|
2017-11-28 20:42:28 +01:00
|
|
|
}
|
|
|
|
|
|
|
|
Status BlobDBImpl::GetImpl(const ReadOptions& read_options,
|
|
|
|
ColumnFamilyHandle* column_family, const Slice& key,
|
2018-08-07 02:28:40 +02:00
|
|
|
PinnableSlice* value, uint64_t* expiration) {
|
2019-12-20 03:03:24 +01:00
|
|
|
if (column_family->GetID() != DefaultColumnFamily()->GetID()) {
|
2017-09-08 19:57:12 +02:00
|
|
|
return Status::NotSupported(
|
|
|
|
"Blob DB doesn't support non-default column family.");
|
|
|
|
}
|
2017-08-21 03:12:38 +02:00
|
|
|
// Get a snapshot to avoid blob file get deleted between we
|
|
|
|
// fetch and index entry and reading from the file.
|
|
|
|
// TODO(yiwu): For Get() retry if file not found would be a simpler strategy.
|
|
|
|
ReadOptions ro(read_options);
|
|
|
|
bool snapshot_created = SetSnapshotIfNeeded(&ro);
|
|
|
|
|
2018-08-28 01:23:48 +02:00
|
|
|
PinnableSlice index_entry;
|
2017-05-10 23:54:35 +02:00
|
|
|
Status s;
|
2017-10-18 02:24:25 +02:00
|
|
|
bool is_blob_index = false;
|
New API to get all merge operands for a Key (#5604)
Summary:
This is a new API added to db.h to allow for fetching all merge operands associated with a Key. The main motivation for this API is to support use cases where doing a full online merge is not necessary as it is performance sensitive. Example use-cases:
1. Update subset of columns and read subset of columns -
Imagine a SQL Table, a row is encoded as a K/V pair (as it is done in MyRocks). If there are many columns and users only updated one of them, we can use merge operator to reduce write amplification. While users only read one or two columns in the read query, this feature can avoid a full merging of the whole row, and save some CPU.
2. Updating very few attributes in a value which is a JSON-like document -
Updating one attribute can be done efficiently using merge operator, while reading back one attribute can be done more efficiently if we don't need to do a full merge.
----------------------------------------------------------------------------------------------------
API :
Status GetMergeOperands(
const ReadOptions& options, ColumnFamilyHandle* column_family,
const Slice& key, PinnableSlice* merge_operands,
GetMergeOperandsOptions* get_merge_operands_options,
int* number_of_operands)
Example usage :
int size = 100;
int number_of_operands = 0;
std::vector<PinnableSlice> values(size);
GetMergeOperandsOptions merge_operands_info;
db_->GetMergeOperands(ReadOptions(), db_->DefaultColumnFamily(), "k1", values.data(), merge_operands_info, &number_of_operands);
Description :
Returns all the merge operands corresponding to the key. If the number of merge operands in DB is greater than merge_operands_options.expected_max_number_of_operands no merge operands are returned and status is Incomplete. Merge operands returned are in the order of insertion.
merge_operands-> Points to an array of at-least merge_operands_options.expected_max_number_of_operands and the caller is responsible for allocating it. If the status returned is Incomplete then number_of_operands will contain the total number of merge operands found in DB for key.
Pull Request resolved: https://github.com/facebook/rocksdb/pull/5604
Test Plan:
Added unit test and perf test in db_bench that can be run using the command:
./db_bench -benchmarks=getmergeoperands --merge_operator=sortlist
Differential Revision: D16657366
Pulled By: vjnadimpalli
fbshipit-source-id: 0faadd752351745224ee12d4ae9ef3cb529951bf
2019-08-06 23:22:34 +02:00
|
|
|
DBImpl::GetImplOptions get_impl_options;
|
|
|
|
get_impl_options.column_family = column_family;
|
|
|
|
get_impl_options.value = &index_entry;
|
|
|
|
get_impl_options.is_blob_index = &is_blob_index;
|
|
|
|
s = db_impl_->GetImpl(ro, key, get_impl_options);
|
2018-08-07 02:28:40 +02:00
|
|
|
if (expiration != nullptr) {
|
|
|
|
*expiration = kNoExpiration;
|
|
|
|
}
|
2018-08-28 01:23:48 +02:00
|
|
|
RecordTick(statistics_, BLOB_DB_NUM_KEYS_READ);
|
|
|
|
if (s.ok()) {
|
|
|
|
if (is_blob_index) {
|
|
|
|
s = GetBlobValue(key, index_entry, value, expiration);
|
|
|
|
} else {
|
|
|
|
// The index entry is the value itself in this case.
|
|
|
|
value->PinSelf(index_entry);
|
|
|
|
}
|
|
|
|
RecordTick(statistics_, BLOB_DB_BYTES_READ, value->size());
|
2017-08-21 03:12:38 +02:00
|
|
|
}
|
|
|
|
if (snapshot_created) {
|
|
|
|
db_->ReleaseSnapshot(ro.snapshot);
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
return s;
|
|
|
|
}
|
|
|
|
|
|
|
|
std::pair<bool, int64_t> BlobDBImpl::SanityCheck(bool aborted) {
|
2018-08-30 20:43:39 +02:00
|
|
|
if (aborted) {
|
|
|
|
return std::make_pair(false, -1);
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-08-15 01:07:03 +02:00
|
|
|
ReadLock rl(&mutex_);
|
|
|
|
|
2017-07-13 19:03:39 +02:00
|
|
|
ROCKS_LOG_INFO(db_options_.info_log, "Starting Sanity Check");
|
2019-04-04 21:05:42 +02:00
|
|
|
ROCKS_LOG_INFO(db_options_.info_log, "Number of files %" ROCKSDB_PRIszt,
|
2017-07-13 19:03:39 +02:00
|
|
|
blob_files_.size());
|
2019-04-04 21:05:42 +02:00
|
|
|
ROCKS_LOG_INFO(db_options_.info_log, "Number of open files %" ROCKSDB_PRIszt,
|
2017-11-01 00:33:55 +01:00
|
|
|
open_ttl_files_.size());
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
for (const auto& blob_file : open_ttl_files_) {
|
|
|
|
(void)blob_file;
|
|
|
|
assert(!blob_file->Immutable());
|
|
|
|
}
|
|
|
|
|
|
|
|
for (const auto& pair : live_imm_non_ttl_blob_files_) {
|
|
|
|
const auto& blob_file = pair.second;
|
|
|
|
(void)blob_file;
|
|
|
|
assert(!blob_file->HasTTL());
|
|
|
|
assert(blob_file->Immutable());
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2018-08-30 20:43:39 +02:00
|
|
|
uint64_t now = EpochNow();
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2018-08-30 20:43:39 +02:00
|
|
|
for (auto blob_file_pair : blob_files_) {
|
|
|
|
auto blob_file = blob_file_pair.second;
|
|
|
|
char buf[1000];
|
|
|
|
int pos = snprintf(buf, sizeof(buf),
|
|
|
|
"Blob file %" PRIu64 ", size %" PRIu64
|
|
|
|
", blob count %" PRIu64 ", immutable %d",
|
|
|
|
blob_file->BlobFileNumber(), blob_file->GetFileSize(),
|
|
|
|
blob_file->BlobCount(), blob_file->Immutable());
|
|
|
|
if (blob_file->HasTTL()) {
|
2019-08-15 01:07:03 +02:00
|
|
|
ExpirationRange expiration_range;
|
|
|
|
|
|
|
|
{
|
|
|
|
ReadLock file_lock(&blob_file->mutex_);
|
|
|
|
expiration_range = blob_file->GetExpirationRange();
|
|
|
|
}
|
|
|
|
|
2018-08-30 20:43:39 +02:00
|
|
|
pos += snprintf(buf + pos, sizeof(buf) - pos,
|
|
|
|
", expiration range (%" PRIu64 ", %" PRIu64 ")",
|
|
|
|
expiration_range.first, expiration_range.second);
|
|
|
|
if (!blob_file->Obsolete()) {
|
|
|
|
pos += snprintf(buf + pos, sizeof(buf) - pos,
|
|
|
|
", expire in %" PRIu64 " seconds",
|
|
|
|
expiration_range.second - now);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
if (blob_file->Obsolete()) {
|
|
|
|
pos += snprintf(buf + pos, sizeof(buf) - pos, ", obsolete at %" PRIu64,
|
|
|
|
blob_file->GetObsoleteSequence());
|
|
|
|
}
|
|
|
|
snprintf(buf + pos, sizeof(buf) - pos, ".");
|
|
|
|
ROCKS_LOG_INFO(db_options_.info_log, "%s", buf);
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
// reschedule
|
|
|
|
return std::make_pair(true, -1);
|
|
|
|
}
|
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
Status BlobDBImpl::CloseBlobFile(std::shared_ptr<BlobFile> bfile) {
|
2020-06-30 02:30:04 +02:00
|
|
|
TEST_SYNC_POINT("BlobDBImpl::CloseBlobFile");
|
2019-11-19 01:28:04 +01:00
|
|
|
assert(bfile);
|
|
|
|
assert(!bfile->Immutable());
|
|
|
|
assert(!bfile->Obsolete());
|
2019-12-13 19:11:03 +01:00
|
|
|
|
|
|
|
if (bfile->HasTTL() || bfile == open_non_ttl_file_) {
|
|
|
|
write_mutex_.AssertHeld();
|
|
|
|
}
|
2019-11-19 01:28:04 +01:00
|
|
|
|
2017-11-21 06:06:30 +01:00
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"Closing blob file %" PRIu64 ". Path: %s",
|
|
|
|
bfile->BlobFileNumber(), bfile->PathName().c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
const SequenceNumber sequence = GetLatestSequenceNumber();
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
const Status s = bfile->WriteFooterAndCloseLocked(sequence);
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
if (s.ok()) {
|
|
|
|
total_blob_size_ += BlobLogFooter::kSize;
|
|
|
|
} else {
|
2019-11-19 01:28:04 +01:00
|
|
|
bfile->MarkImmutable(sequence);
|
|
|
|
|
2017-08-25 19:40:25 +02:00
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
|
|
|
"Failed to close blob file %" PRIu64 "with error: %s",
|
|
|
|
bfile->BlobFileNumber(), s.ToString().c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
if (bfile->HasTTL()) {
|
|
|
|
size_t erased __attribute__((__unused__));
|
|
|
|
erased = open_ttl_files_.erase(bfile);
|
|
|
|
} else {
|
|
|
|
if (bfile == open_non_ttl_file_) {
|
|
|
|
open_non_ttl_file_ = nullptr;
|
|
|
|
}
|
|
|
|
|
|
|
|
const uint64_t blob_file_number = bfile->BlobFileNumber();
|
|
|
|
auto it = live_imm_non_ttl_blob_files_.lower_bound(blob_file_number);
|
|
|
|
assert(it == live_imm_non_ttl_blob_files_.end() ||
|
|
|
|
it->first != blob_file_number);
|
|
|
|
live_imm_non_ttl_blob_files_.insert(
|
|
|
|
it, std::map<uint64_t, std::shared_ptr<BlobFile>>::value_type(
|
|
|
|
blob_file_number, bfile));
|
|
|
|
}
|
|
|
|
|
2017-08-25 19:40:25 +02:00
|
|
|
return s;
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2017-08-25 19:40:25 +02:00
|
|
|
Status BlobDBImpl::CloseBlobFileIfNeeded(std::shared_ptr<BlobFile>& bfile) {
|
2019-11-19 01:28:04 +01:00
|
|
|
write_mutex_.AssertHeld();
|
|
|
|
|
2017-08-25 19:40:25 +02:00
|
|
|
// atomic read
|
|
|
|
if (bfile->GetFileSize() < bdb_options_.blob_file_size) {
|
|
|
|
return Status::OK();
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
2019-11-19 01:28:04 +01:00
|
|
|
|
|
|
|
WriteLock lock(&mutex_);
|
|
|
|
WriteLock file_lock(&bfile->mutex_);
|
|
|
|
|
|
|
|
assert(!bfile->Obsolete() || bfile->Immutable());
|
|
|
|
if (bfile->Immutable()) {
|
|
|
|
return Status::OK();
|
|
|
|
}
|
|
|
|
|
2017-08-25 19:40:25 +02:00
|
|
|
return CloseBlobFile(bfile);
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
void BlobDBImpl::ObsoleteBlobFile(std::shared_ptr<BlobFile> blob_file,
|
|
|
|
SequenceNumber obsolete_seq,
|
|
|
|
bool update_size) {
|
2019-11-19 01:28:04 +01:00
|
|
|
assert(blob_file->Immutable());
|
|
|
|
assert(!blob_file->Obsolete());
|
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
// Should hold write lock of mutex_ or during DB open.
|
|
|
|
blob_file->MarkObsolete(obsolete_seq);
|
|
|
|
obsolete_files_.push_back(blob_file);
|
|
|
|
assert(total_blob_size_.load() >= blob_file->GetFileSize());
|
|
|
|
if (update_size) {
|
|
|
|
total_blob_size_ -= blob_file->GetFileSize();
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2017-11-02 23:50:30 +01:00
|
|
|
bool BlobDBImpl::VisibleToActiveSnapshot(
|
2017-05-10 23:54:35 +02:00
|
|
|
const std::shared_ptr<BlobFile>& bfile) {
|
|
|
|
assert(bfile->Obsolete());
|
2017-12-15 22:18:32 +01:00
|
|
|
|
|
|
|
// We check whether the oldest snapshot is no less than the last sequence
|
|
|
|
// by the time the blob file become obsolete. If so, the blob file is not
|
|
|
|
// visible to all existing snapshots.
|
|
|
|
//
|
|
|
|
// If we keep track of the earliest sequence of the keys in the blob file,
|
|
|
|
// we could instead check if there's a snapshot falls in range
|
|
|
|
// [earliest_sequence, obsolete_sequence). But doing so will make the
|
|
|
|
// implementation more complicated.
|
2017-11-02 23:50:30 +01:00
|
|
|
SequenceNumber obsolete_sequence = bfile->GetObsoleteSequence();
|
2018-08-07 01:45:02 +02:00
|
|
|
SequenceNumber oldest_snapshot = kMaxSequenceNumber;
|
2017-12-15 22:18:32 +01:00
|
|
|
{
|
|
|
|
// Need to lock DBImpl mutex before access snapshot list.
|
|
|
|
InstrumentedMutexLock l(db_impl_->mutex());
|
2018-08-07 01:45:02 +02:00
|
|
|
auto& snapshots = db_impl_->snapshots();
|
2017-12-15 22:18:32 +01:00
|
|
|
if (!snapshots.empty()) {
|
|
|
|
oldest_snapshot = snapshots.oldest()->GetSequenceNumber();
|
|
|
|
}
|
|
|
|
}
|
2018-08-30 20:43:39 +02:00
|
|
|
bool visible = oldest_snapshot < obsolete_sequence;
|
|
|
|
if (visible) {
|
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"Obsolete blob file %" PRIu64 " (obsolete at %" PRIu64
|
|
|
|
") visible to oldest snapshot %" PRIu64 ".",
|
|
|
|
bfile->BlobFileNumber(), obsolete_sequence, oldest_snapshot);
|
|
|
|
}
|
|
|
|
return visible;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2018-08-21 07:38:34 +02:00
|
|
|
std::pair<bool, int64_t> BlobDBImpl::EvictExpiredFiles(bool aborted) {
|
|
|
|
if (aborted) {
|
|
|
|
return std::make_pair(false, -1);
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-02-22 02:23:05 +01:00
|
|
|
TEST_SYNC_POINT("BlobDBImpl::EvictExpiredFiles:0");
|
|
|
|
TEST_SYNC_POINT("BlobDBImpl::EvictExpiredFiles:1");
|
|
|
|
|
2017-05-10 23:54:35 +02:00
|
|
|
std::vector<std::shared_ptr<BlobFile>> process_files;
|
2018-08-21 07:38:34 +02:00
|
|
|
uint64_t now = EpochNow();
|
2017-05-10 23:54:35 +02:00
|
|
|
{
|
|
|
|
ReadLock rl(&mutex_);
|
2018-08-21 07:38:34 +02:00
|
|
|
for (auto p : blob_files_) {
|
|
|
|
auto& blob_file = p.second;
|
|
|
|
ReadLock file_lock(&blob_file->mutex_);
|
|
|
|
if (blob_file->HasTTL() && !blob_file->Obsolete() &&
|
|
|
|
blob_file->GetExpirationRange().second <= now) {
|
|
|
|
process_files.push_back(blob_file);
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2019-02-22 02:23:05 +01:00
|
|
|
TEST_SYNC_POINT("BlobDBImpl::EvictExpiredFiles:2");
|
|
|
|
TEST_SYNC_POINT("BlobDBImpl::EvictExpiredFiles:3");
|
|
|
|
TEST_SYNC_POINT_CALLBACK("BlobDBImpl::EvictExpiredFiles:cb", nullptr);
|
|
|
|
|
2018-08-21 07:38:34 +02:00
|
|
|
SequenceNumber seq = GetLatestSequenceNumber();
|
|
|
|
{
|
|
|
|
MutexLock l(&write_mutex_);
|
2019-11-19 01:28:04 +01:00
|
|
|
WriteLock lock(&mutex_);
|
2018-08-21 07:38:34 +02:00
|
|
|
for (auto& blob_file : process_files) {
|
|
|
|
WriteLock file_lock(&blob_file->mutex_);
|
2019-11-19 01:28:04 +01:00
|
|
|
|
2018-08-21 07:38:34 +02:00
|
|
|
// Need to double check if the file is obsolete.
|
2019-11-19 01:28:04 +01:00
|
|
|
if (blob_file->Obsolete()) {
|
|
|
|
assert(blob_file->Immutable());
|
|
|
|
continue;
|
2018-08-21 07:38:34 +02:00
|
|
|
}
|
2019-11-19 01:28:04 +01:00
|
|
|
|
|
|
|
if (!blob_file->Immutable()) {
|
|
|
|
CloseBlobFile(blob_file);
|
|
|
|
}
|
|
|
|
|
|
|
|
assert(blob_file->Immutable());
|
|
|
|
|
|
|
|
ObsoleteBlobFile(blob_file, seq, true /*update_size*/);
|
2018-08-21 07:38:34 +02:00
|
|
|
}
|
2017-08-21 01:56:01 +02:00
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
return std::make_pair(true, -1);
|
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
Status BlobDBImpl::SyncBlobFiles() {
|
2017-08-04 22:09:56 +02:00
|
|
|
MutexLock l(&write_mutex_);
|
|
|
|
|
2017-05-10 23:54:35 +02:00
|
|
|
std::vector<std::shared_ptr<BlobFile>> process_files;
|
|
|
|
{
|
|
|
|
ReadLock rl(&mutex_);
|
2017-11-01 00:33:55 +01:00
|
|
|
for (auto fitr : open_ttl_files_) {
|
2017-12-20 01:34:25 +01:00
|
|
|
process_files.push_back(fitr);
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
2017-12-20 01:34:25 +01:00
|
|
|
if (open_non_ttl_file_ != nullptr) {
|
2017-11-01 00:33:55 +01:00
|
|
|
process_files.push_back(open_non_ttl_file_);
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2017-12-11 21:01:22 +01:00
|
|
|
Status s;
|
|
|
|
for (auto& blob_file : process_files) {
|
2017-12-20 01:34:25 +01:00
|
|
|
s = blob_file->Fsync();
|
|
|
|
if (!s.ok()) {
|
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
|
|
|
"Failed to sync blob file %" PRIu64 ", status: %s",
|
|
|
|
blob_file->BlobFileNumber(), s.ToString().c_str());
|
|
|
|
return s;
|
2017-12-11 21:01:22 +01:00
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2017-12-20 01:34:25 +01:00
|
|
|
s = dir_ent_->Fsync();
|
|
|
|
if (!s.ok()) {
|
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
|
|
|
"Failed to sync blob directory, status: %s",
|
|
|
|
s.ToString().c_str());
|
2017-12-11 21:01:22 +01:00
|
|
|
}
|
|
|
|
return s;
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
std::pair<bool, int64_t> BlobDBImpl::ReclaimOpenFiles(bool aborted) {
|
|
|
|
if (aborted) return std::make_pair(false, -1);
|
|
|
|
|
2017-08-01 21:48:22 +02:00
|
|
|
if (open_file_count_.load() < kOpenFilesTrigger) {
|
2017-05-10 23:54:35 +02:00
|
|
|
return std::make_pair(true, -1);
|
2017-08-01 21:48:22 +02:00
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
// in the future, we should sort by last_access_
|
|
|
|
// instead of closing every file
|
|
|
|
ReadLock rl(&mutex_);
|
|
|
|
for (auto const& ent : blob_files_) {
|
|
|
|
auto bfile = ent.second;
|
|
|
|
if (bfile->last_access_.load() == -1) continue;
|
|
|
|
|
|
|
|
WriteLock lockbfile_w(&bfile->mutex_);
|
|
|
|
CloseRandomAccessLocked(bfile);
|
|
|
|
}
|
|
|
|
|
|
|
|
return std::make_pair(true, -1);
|
|
|
|
}
|
|
|
|
|
2017-08-21 03:12:38 +02:00
|
|
|
std::pair<bool, int64_t> BlobDBImpl::DeleteObsoleteFiles(bool aborted) {
|
2018-08-27 19:56:28 +02:00
|
|
|
if (aborted) {
|
|
|
|
return std::make_pair(false, -1);
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2018-08-27 19:56:28 +02:00
|
|
|
MutexLock delete_file_lock(&delete_file_mutex_);
|
|
|
|
if (disable_file_deletions_ > 0) {
|
|
|
|
return std::make_pair(true, -1);
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
std::list<std::shared_ptr<BlobFile>> tobsolete;
|
|
|
|
{
|
|
|
|
WriteLock wl(&mutex_);
|
2018-08-27 19:56:28 +02:00
|
|
|
if (obsolete_files_.empty()) {
|
|
|
|
return std::make_pair(true, -1);
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
tobsolete.swap(obsolete_files_);
|
|
|
|
}
|
|
|
|
|
|
|
|
bool file_deleted = false;
|
|
|
|
for (auto iter = tobsolete.begin(); iter != tobsolete.end();) {
|
|
|
|
auto bfile = *iter;
|
|
|
|
{
|
|
|
|
ReadLock lockbfile_r(&bfile->mutex_);
|
2017-11-02 23:50:30 +01:00
|
|
|
if (VisibleToActiveSnapshot(bfile)) {
|
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"Could not delete file due to snapshot failure %s",
|
|
|
|
bfile->PathName().c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
++iter;
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
}
|
2017-11-02 23:50:30 +01:00
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"Will delete file due to snapshot success %s",
|
|
|
|
bfile->PathName().c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
|
2019-08-15 01:07:03 +02:00
|
|
|
{
|
|
|
|
WriteLock wl(&mutex_);
|
|
|
|
blob_files_.erase(bfile->BlobFileNumber());
|
|
|
|
}
|
|
|
|
|
2019-01-29 23:27:30 +01:00
|
|
|
Status s = DeleteDBFile(&(db_impl_->immutable_db_options()),
|
2019-07-07 06:04:22 +02:00
|
|
|
bfile->PathName(), blob_dir_, true,
|
|
|
|
/*force_fg=*/false);
|
2017-05-10 23:54:35 +02:00
|
|
|
if (!s.ok()) {
|
2017-07-13 19:03:39 +02:00
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log,
|
|
|
|
"File failed to be deleted as obsolete %s",
|
|
|
|
bfile->PathName().c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
++iter;
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
|
|
|
|
file_deleted = true;
|
2017-07-13 19:03:39 +02:00
|
|
|
ROCKS_LOG_INFO(db_options_.info_log,
|
|
|
|
"File deleted as obsolete from blob dir %s",
|
|
|
|
bfile->PathName().c_str());
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
iter = tobsolete.erase(iter);
|
|
|
|
}
|
|
|
|
|
|
|
|
// directory change. Fsync
|
2017-11-02 20:02:42 +01:00
|
|
|
if (file_deleted) {
|
2018-09-14 22:17:12 +02:00
|
|
|
Status s = dir_ent_->Fsync();
|
|
|
|
if (!s.ok()) {
|
|
|
|
ROCKS_LOG_ERROR(db_options_.info_log, "Failed to sync dir %s: %s",
|
|
|
|
blob_dir_.c_str(), s.ToString().c_str());
|
|
|
|
}
|
2017-11-02 20:02:42 +01:00
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
|
|
|
|
// put files back into obsolete if for some reason, delete failed
|
|
|
|
if (!tobsolete.empty()) {
|
|
|
|
WriteLock wl(&mutex_);
|
2017-08-21 03:12:38 +02:00
|
|
|
for (auto bfile : tobsolete) {
|
2019-08-15 01:07:03 +02:00
|
|
|
blob_files_.insert(std::make_pair(bfile->BlobFileNumber(), bfile));
|
2017-08-21 03:12:38 +02:00
|
|
|
obsolete_files_.push_front(bfile);
|
|
|
|
}
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
return std::make_pair(!aborted, -1);
|
|
|
|
}
|
|
|
|
|
|
|
|
void BlobDBImpl::CopyBlobFiles(
|
2018-06-26 07:32:29 +02:00
|
|
|
std::vector<std::shared_ptr<BlobFile>>* bfiles_copy) {
|
2017-05-10 23:54:35 +02:00
|
|
|
ReadLock rl(&mutex_);
|
2017-08-21 01:56:01 +02:00
|
|
|
for (auto const& p : blob_files_) {
|
2018-06-26 07:32:29 +02:00
|
|
|
bfiles_copy->push_back(p.second);
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2017-09-08 19:57:12 +02:00
|
|
|
Iterator* BlobDBImpl::NewIterator(const ReadOptions& read_options) {
|
2017-10-18 02:24:25 +02:00
|
|
|
auto* cfd =
|
2020-07-03 04:24:25 +02:00
|
|
|
static_cast_with_check<ColumnFamilyHandleImpl>(DefaultColumnFamily())
|
|
|
|
->cfd();
|
2017-08-21 03:12:38 +02:00
|
|
|
// Get a snapshot to avoid blob file get deleted between we
|
|
|
|
// fetch and index entry and reading from the file.
|
2017-10-18 02:24:25 +02:00
|
|
|
ManagedSnapshot* own_snapshot = nullptr;
|
|
|
|
const Snapshot* snapshot = read_options.snapshot;
|
|
|
|
if (snapshot == nullptr) {
|
|
|
|
own_snapshot = new ManagedSnapshot(db_);
|
|
|
|
snapshot = own_snapshot->snapshot();
|
|
|
|
}
|
|
|
|
auto* iter = db_impl_->NewIteratorImpl(
|
|
|
|
read_options, cfd, snapshot->GetSequenceNumber(),
|
|
|
|
nullptr /*read_callback*/, true /*allow_blob*/);
|
2017-11-28 20:42:28 +01:00
|
|
|
return new BlobDBIterator(own_snapshot, iter, this, env_, statistics_);
|
2017-05-10 23:54:35 +02:00
|
|
|
}
|
|
|
|
|
2017-06-14 22:08:54 +02:00
|
|
|
Status DestroyBlobDB(const std::string& dbname, const Options& options,
|
|
|
|
const BlobDBOptions& bdb_options) {
|
|
|
|
const ImmutableDBOptions soptions(SanitizeOptions(dbname, options));
|
|
|
|
Env* env = soptions.env;
|
|
|
|
|
|
|
|
Status status;
|
|
|
|
std::string blobdir;
|
|
|
|
blobdir = (bdb_options.path_relative) ? dbname + "/" + bdb_options.blob_dir
|
|
|
|
: bdb_options.blob_dir;
|
|
|
|
|
|
|
|
std::vector<std::string> filenames;
|
|
|
|
env->GetChildren(blobdir, &filenames);
|
|
|
|
|
|
|
|
for (const auto& f : filenames) {
|
|
|
|
uint64_t number;
|
|
|
|
FileType type;
|
|
|
|
if (ParseFileName(f, &number, &type) && type == kBlobFile) {
|
2019-07-07 06:04:22 +02:00
|
|
|
Status del = DeleteDBFile(&soptions, blobdir + "/" + f, blobdir, true,
|
|
|
|
/*force_fg=*/false);
|
2017-06-14 22:08:54 +02:00
|
|
|
if (status.ok() && !del.ok()) {
|
|
|
|
status = del;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
env->DeleteDir(blobdir);
|
|
|
|
|
|
|
|
Status destroy = DestroyDB(dbname, options);
|
|
|
|
if (status.ok() && !destroy.ok()) {
|
|
|
|
status = destroy;
|
|
|
|
}
|
|
|
|
|
|
|
|
return status;
|
|
|
|
}
|
|
|
|
|
2017-05-31 19:45:47 +02:00
|
|
|
#ifndef NDEBUG
|
Blob DB: Inline small values in base DB
Summary:
Adding the `min_blob_size` option to allow storing small values in base db (in LSM tree) together with the key. The goal is to improve performance for small values, while taking advantage of blob db's low write amplification for large values.
Also adding expiration timestamp to blob index. It will be useful to evict stale blob indexes in base db by adding a compaction filter. I'll work on the compaction filter in future patches.
See blob_index.h for the new blob index format. There are 4 cases when writing a new key:
* small value w/o TTL: put in base db as normal value (i.e. ValueType::kTypeValue)
* small value w/ TTL: put (type, expiration, value) to base db.
* large value w/o TTL: write value to blob log and put (type, file, offset, size, compression) to base db.
* large value w/TTL: write value to blob log and put (type, expiration, file, offset, size, compression) to base db.
Closes https://github.com/facebook/rocksdb/pull/3066
Differential Revision: D6142115
Pulled By: yiwu-arbug
fbshipit-source-id: 9526e76e19f0839310a3f5f2a43772a4ad182cd0
2017-10-26 21:19:43 +02:00
|
|
|
Status BlobDBImpl::TEST_GetBlobValue(const Slice& key, const Slice& index_entry,
|
|
|
|
PinnableSlice* value) {
|
|
|
|
return GetBlobValue(key, index_entry, value);
|
|
|
|
}
|
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
void BlobDBImpl::TEST_AddDummyBlobFile(uint64_t blob_file_number,
|
|
|
|
SequenceNumber immutable_sequence) {
|
|
|
|
auto blob_file = std::make_shared<BlobFile>(this, blob_dir_, blob_file_number,
|
|
|
|
db_options_.info_log.get());
|
|
|
|
blob_file->MarkImmutable(immutable_sequence);
|
|
|
|
|
|
|
|
blob_files_[blob_file_number] = blob_file;
|
|
|
|
live_imm_non_ttl_blob_files_[blob_file_number] = blob_file;
|
2019-11-11 23:00:25 +01:00
|
|
|
}
|
|
|
|
|
2017-07-28 08:16:18 +02:00
|
|
|
std::vector<std::shared_ptr<BlobFile>> BlobDBImpl::TEST_GetBlobFiles() const {
|
2017-08-21 03:12:38 +02:00
|
|
|
ReadLock l(&mutex_);
|
2017-07-28 08:16:18 +02:00
|
|
|
std::vector<std::shared_ptr<BlobFile>> blob_files;
|
|
|
|
for (auto& p : blob_files_) {
|
|
|
|
blob_files.emplace_back(p.second);
|
|
|
|
}
|
|
|
|
return blob_files;
|
|
|
|
}
|
|
|
|
|
2019-11-19 01:28:04 +01:00
|
|
|
std::vector<std::shared_ptr<BlobFile>> BlobDBImpl::TEST_GetLiveImmNonTTLFiles()
|
|
|
|
const {
|
|
|
|
ReadLock l(&mutex_);
|
|
|
|
std::vector<std::shared_ptr<BlobFile>> live_imm_non_ttl_files;
|
|
|
|
for (const auto& pair : live_imm_non_ttl_blob_files_) {
|
|
|
|
live_imm_non_ttl_files.emplace_back(pair.second);
|
|
|
|
}
|
|
|
|
return live_imm_non_ttl_files;
|
|
|
|
}
|
|
|
|
|
2017-08-21 01:56:01 +02:00
|
|
|
std::vector<std::shared_ptr<BlobFile>> BlobDBImpl::TEST_GetObsoleteFiles()
|
|
|
|
const {
|
|
|
|
ReadLock l(&mutex_);
|
|
|
|
std::vector<std::shared_ptr<BlobFile>> obsolete_files;
|
|
|
|
for (auto& bfile : obsolete_files_) {
|
|
|
|
obsolete_files.emplace_back(bfile);
|
|
|
|
}
|
|
|
|
return obsolete_files;
|
|
|
|
}
|
|
|
|
|
2017-08-21 03:12:38 +02:00
|
|
|
void BlobDBImpl::TEST_DeleteObsoleteFiles() {
|
|
|
|
DeleteObsoleteFiles(false /*abort*/);
|
|
|
|
}
|
|
|
|
|
2017-08-25 19:40:25 +02:00
|
|
|
Status BlobDBImpl::TEST_CloseBlobFile(std::shared_ptr<BlobFile>& bfile) {
|
2018-03-06 20:46:20 +01:00
|
|
|
MutexLock l(&write_mutex_);
|
2019-11-19 01:28:04 +01:00
|
|
|
WriteLock lock(&mutex_);
|
|
|
|
WriteLock file_lock(&bfile->mutex_);
|
|
|
|
|
2017-08-25 19:40:25 +02:00
|
|
|
return CloseBlobFile(bfile);
|
2017-07-28 08:16:18 +02:00
|
|
|
}
|
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
void BlobDBImpl::TEST_ObsoleteBlobFile(std::shared_ptr<BlobFile>& blob_file,
|
|
|
|
SequenceNumber obsolete_seq,
|
|
|
|
bool update_size) {
|
|
|
|
return ObsoleteBlobFile(blob_file, obsolete_seq, update_size);
|
|
|
|
}
|
|
|
|
|
2018-08-21 07:38:34 +02:00
|
|
|
void BlobDBImpl::TEST_EvictExpiredFiles() {
|
|
|
|
EvictExpiredFiles(false /*abort*/);
|
|
|
|
}
|
|
|
|
|
2018-03-06 20:46:20 +01:00
|
|
|
uint64_t BlobDBImpl::TEST_live_sst_size() { return live_sst_size_.load(); }
|
2019-11-11 23:00:25 +01:00
|
|
|
|
|
|
|
void BlobDBImpl::TEST_InitializeBlobFileToSstMapping(
|
|
|
|
const std::vector<LiveFileMetaData>& live_files) {
|
|
|
|
InitializeBlobFileToSstMapping(live_files);
|
|
|
|
}
|
|
|
|
|
|
|
|
void BlobDBImpl::TEST_ProcessFlushJobInfo(const FlushJobInfo& info) {
|
|
|
|
ProcessFlushJobInfo(info);
|
|
|
|
}
|
|
|
|
|
|
|
|
void BlobDBImpl::TEST_ProcessCompactionJobInfo(const CompactionJobInfo& info) {
|
|
|
|
ProcessCompactionJobInfo(info);
|
|
|
|
}
|
|
|
|
|
2017-05-31 19:45:47 +02:00
|
|
|
#endif // !NDEBUG
|
|
|
|
|
2017-05-10 23:54:35 +02:00
|
|
|
} // namespace blob_db
|
2020-02-20 21:07:53 +01:00
|
|
|
} // namespace ROCKSDB_NAMESPACE
|
2017-05-10 23:54:35 +02:00
|
|
|
#endif // ROCKSDB_LITE
|